Factor the expression completely. 12X+18

Answers

Answer 1

Answer:

6(2x+3)

Step-by-step explanation:

There's really no way to explain this. Take the number that all of the numbers in the equation can be divisible by and then single it out and then yeah.

Hope this helped! :)


Related Questions

What are the finance charges?



$3.79


$4.68


$5.32


$7.50

Answers

Answer:

These types of finance charges include things such as annual fees for credit cards, account maintenance fees, late fees charged for making loan or credit card payments past the due date, and account transaction fees.

Answer:

3.79

Step-by-step explanation:

took the test and got the answer. Hope this helps!

Let X₁, X₂, X₃, ... be i.i.d. variables taking values between +1 and +[infinity] with probability density given by:
f(x) = (λ - 1)/x^λ
for every x ≥ 1 where λ > 1 is an unknown parameter. For x < 1, we assume the probability density to be 0. Estimate λ using maximum likelihood, given X₁ = 3, X₂ = 4, X₃ = 5

Answers

To estimate the unknown parameter λ using maximum likelihood, given X₁ = 3, X₂ = 4, X₃ = 5, we need to find the value of λ that maximizes the likelihood function based on the observed data. The likelihood function represents the probability of observing the given data for different values of λ.

The likelihood function L(λ) is defined as the product of the probability density function evaluated at each observed data point. In this case, we have L(λ) = f(3) * f(4) * f(5), where f(x) is the given probability density function.
Substituting the values into the likelihood function, we have L(λ) = ((λ - 1)/3^λ) * ((λ - 1)/4^λ) * ((λ - 1)/5^λ).
To find the maximum likelihood estimate of λ, we need to maximize the likelihood function. Taking the natural logarithm of the likelihood function (ln L(λ)), we can simplify the problem to finding the value of λ that maximizes ln L(λ).
Taking the derivative of ln L(λ) with respect to λ and setting it to zero, we can solve for the maximum likelihood estimate of λ.
By solving the equation, we can obtain the estimate for λ based on the observed data X₁ = 3, X₂ = 4, X₃ = 5.

learn more about probability here

https://brainly.com/question/30034780



#SPJ11

A bakery sells glazed donuts for $1.09 each. Cinnamon bagels and onion bagels are $1.59 each. Max buys x donuts, y cinnamon bagels, and z onion bagels. Which expression represents the total amount Max spent at the bakery?
A.
1.09x + 1.59yz
B.
1.09x + 1.59y + 1.59z
C.
1.09x + 3.18(y + z)
D.
(1.09 + 1.59)(x + y + z)

Answers

Answer:

The answer is B.

Step-by-step explanation:

Answer:

B.

1.09x + 1.59y + 1.59z

I hope this helps

For males in a certain town, the systolic blood pressure is normally distributed with a mean of 105 and a standard deviation of 7. Using the empirical rule, what percentage of males in the town have a systolic blood pressure between 98 and 112?

Answers

Answer:

Answer:

68%

Step-by-step explanation:

The percentage of males in the town who have systolic blood pressure between 98 and 112 is 68%.

What is a normal distribution?

It is also called the Gaussian Distribution. It is the most important continuous probability distribution. The curve looks like a bell, so it is also called a bell curve.

For males in a certain town, the systolic blood pressure is normally distributed with a mean of 105 and a standard deviation of 7.

68 percent of the data is within one standard deviation of the mean, i.e. between μ - σ and μ + σ.

μ - σ = 105 - 7 = 98

μ + σ = 105 + 7 = 112

More about the normal distribution link is given below.

https://brainly.com/question/12421652

PLEASEEEE HELP!!! 20 point for this

Answers

Answer:

Let x be the number of hours Jose worked washing cars last week and y be the number of hours Jose worked waking dogs last week.

10x + 9y = 122

x + y = 13

Avery signed up for a streaming music service where there's a fixed cost for monthly
membership and a cost per song downloaded. Her total cost is given by the linear
graph below. What is the meaning of the point (1,9.24)?
S19.24
S17.99
A) How much the streaming service
charges per downloaded song.
$16.74
S15.49
B) The base cost of the streaming service
S14.24
per month.
Total Cost per Month
$12.90
SEL.74
C) A total cost of 9.24 per month when
one song is downloaded.
SI0.49
D) The cost to download 100 songs.
59.24
57.90
Number of Songs

Answers

Answer:

c

Step-by-step explanation:

What is the length of the arc on a circle with radius 10 cm intercepted by a 20° angle? Use 3.14 for π. Round the answer to the hundredths place. Enter your answer in the box. cm
a. 3.14 cm
b. 6.28 cm
c. 12.57 cm
d. 25.13 cm

Answers

The length of the arc on a circle with radius 10 cm intercepted by a 20° angle is,

Lenght of arc = 3.48 cm

We have to given that,

In a circle,

Radius = 10 cm

And, Angle = 20 degree

Since, We know that,

Lenght of arc = 2πr (θ/360)

Where, θ is central angle and r is radius.

Substitute all the values,

Lenght of arc = 2πr (θ/360)

Lenght of arc = 2 x 3.14 x 10 (20/360)

Lenght of arc = 3.48 cm

Therefore, the length of the arc on a circle with radius 10 cm intercepted by a 20° angle is,

Lenght of arc = 3.48 cm

Learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ4

which expression is equivalent to 18 * 12 A) 12 * 18) B) 10*8*12) C) (10+8) * (10+12). Please hurry ​

Answers

Answer:

12*18

Step-by-step explanation:

18*12 is the same as 12*18 and they both equal 216

Construct a formal proof of validity for each of the following arguments.

51) ⁓ A

Conclusion: A ⸧ B

52) C

Conclusion: D ⸧ C

53) E ⸧ (F ⸧ G)

Conclusion: F ⸧ (E ⸧G)

Answers

The conclusion F ⸧ (E ⸧ G) is valid

To construct a formal proof of validity for each of the given arguments, we will use logical inference rules.

⁓ A

Conclusion: A ⸧ B

⁓ A (Premise)

A ⸧ ⁓ A (Conjunction, from 1)

A (Simplification, from 2)

B (Modus ponens, from 3)

Therefore, the conclusion A ⸧ B is valid.

C

Conclusion: D ⸧ C

C (Premise)

D ⸧ C (Implication, from 1)

Therefore, the conclusion D ⸧ C is valid.

E ⸧ (F ⸧ G)

Conclusion: F ⸧ (E ⸧ G)

E ⸧ (F ⸧ G) (Premise)

F ⸧ G (Simplification, from 1)

G ⸧ F (Commutation, from 2)

E ⸧ G (Simplification, from 1)

E ⸧ F (Transposition, from 4)

F ⸧ (E ⸧ G) (Implication, from 5)

Therefore, the conclusion F ⸧ (E ⸧ G) is valid.

In all three arguments, we have successfully constructed formal proofs of validity using logical inference rules, demonstrating that the conclusions are logically valid based on the given premises.

Know more about Demonstrating here:

https://brainly.com/question/29361957

#SPJ11

What is 4 minus 3/4

Answers

13/4 or 3 1/4
Hope this helps:)

Angel's Ice Cream Shop sold 235 scoops of marshmallow ice cream yesterday, and they sold 265 scoops of all the other flavors combined. What percentage of the ice cream they sold yesterday was marshmallow ice cream?

Choices:
A: 53%
B: 11%
C: 89%
D: 47%

(Please help, 20 points!)

Answers

Answer:

C : 89%

Step-by-step explanation:

If they sold 235 scoops of marshmallow ice cream and in total of all day they sold a total of 265 scoops of ice cream. 265 - 235 = 30

My answer is C : 89%

Let T : P3 right arrow P3 be the linear transformation satisfying T(1) =2x^2 + 7 , T(x) = -2x + 1, T(x^2) = -2x^2 + x - 2. Find the image of an arbitrary quadratic polynomial ax^2 + bx + c . T(ax^2 + bx + c) =___

Answers

The image of the given arbitrary quadratic polynomial is T([tex]ax^2 + bx + c[/tex]) = [tex](-2a + 2c)x^2 + (-2b + a)x + (-2a + b + 7c)[/tex].

Find the image of the arbitrary quadratic polynomial?

To find the image of the arbitrary quadratic polynomial [tex]ax^2 + bx + c[/tex] under the linear transformation T, we can express the polynomial in terms of the standard basis of P3, which is {[tex]1, x, x^2[/tex]}.

The polynomial [tex]ax^2 + bx + c[/tex] can be written as a linear combination of the basis vectors:

[tex]ax^2 + bx + c = a(x^2) + b(x) + c(1)[/tex]

Since we know the values of T(1), T(x), and T([tex]x^2[/tex]), we can substitute them into the expression:

[tex]T(ax^2 + bx + c) = aT(x^2) + bT(x) + cT(1)[/tex]

Substituting the given values:

[tex]T(ax^2 + bx + c) = a(-2x^2 + x - 2) + b(-2x + 1) + c(2x^2 + 7)[/tex]

Simplifying the expression:[tex]T(ax^2 + bx + c) = (-2ax^2 + ax - 2a) + (-2bx + b) + (2cx^2 + 7c)[/tex]

Combining like terms:

[tex]T(ax^2 + bx + c) = (-2a + 2c)x^2 + (-2b + a)x + (-2a + b + 7c)[/tex]

Therefore, the image of the arbitrary quadratic polynomial [tex]ax^2 + bx + c[/tex] under the linear transformation T is [tex](-2a + 2c)x^2 + (-2b + a)x + (-2a + b + 7c)[/tex].

To know more about quadratic polynomial, refer here:

https://brainly.com/question/17489661

#SPJ4

Details Adults in various age groups were asked if they voted in a recent election. The results were as indicated below. Age Voted? Under 30 30 - 50 Over 50 Yes 35 64 25 56 19 1 No A test is conducted at the a = 0.100 significance level to determine whether age and voting behavior are independent Fill in the expected"table for this independence test. Age Voted? Under 30 30 - 50 Over 50 Yes 88 No Find the value of the chi-square statistic for this independence test.

Answers

The value of the chi-square statistic for this independence test is approximately 82.23.

To calculate the expected values for the independence test, we need to determine the expected number of individuals in each category if age and voting behavior were independent. We can calculate the expected values using the formula:

Expected value = (Row total * Column total) / Total number of observations

Let's calculate the expected values for each category:

Age Voted?         Under 30    30 - 50    Over 50    Total

Yes                       35                  64               25               124

No                        56                  19                 1                 76

Total                     91                  83               26               200

Expected value for "Yes" under "Under 30" category:

Expected value = (91 * 124) / 200 = 56.57 (approximately 57)

Expected value for "No" under "Under 30" category:

Expected value = (91 * 76) / 200 = 34.82 (approximately 35)

Similarly, calculate the expected values for the other categories:

Expected values for "Yes" in the "30 - 50" and "Over 50" categories:

30 - 50: 83 * 124 / 200 ≈ 51.77 (approximately 52)

Over 50: 26 * 124 / 200 ≈ 16.12 (approximately 16)

Expected values for "No" in the "30 - 50" and "Over 50" categories:

30 - 50: 83 * 76 / 200 ≈ 31.63 (approximately 32)

Over 50: 26 * 76 / 200 ≈ 9.88 (approximately 10)

The expected table for the independence test is as follows:

Age Voted?         Under 30    30 - 50    Over 50      Total

Yes                       57                  52               16               124

No                        35                  32               10                76

Total                     91                  83               26               200

To find the chi-square statistic for this independence test, we use the formula:

χ² = Σ [(Observed value - Expected value)² / Expected value]

Now, let's calculate the chi-square statistic by summing the values for each category:

χ² = [(35 - 57)² / 57] + [(64 - 52)² / 52] + [(25 - 16)² / 16] + [(56 - 35)² / 35] + [(19 - 32)² / 32] + [(1 - 10)² / 10]

χ² = 23.09 + 2.46 + 5.06 + 40.69 + 4.53 + 6.4

χ² ≈ 82.23

Therefore, the value of the chi-square statistic for this independence test is approximately 82.23.

To know more about chi-square statistic refer here:

https://brainly.com/question/31057349#

#SPJ11

PLEASE HELP I DON'T UNDERSTAND!!!!!! I WILL MARK!!!

Answers

Answer:

the first one.

Step-by-step explanation:

The answer to the problem is the first answer choice

Bruce recorded how many chocolates hate cach day at Worle last week
:
H
1
5
6
7
Number of chocolates
Find the mean number of chocolates.
G

Answers

if you add them all up then the answer is 19!

Answer:

3.8

Step-by-step

Got it wrong so you could get it right

which expression is equivalent to (6 •p) + 3 ?​

Answers

Answer:

3+(p.6)

Step-by-step explanation:

Answer:

3 + (p • 6)

Step-by-step explanation:


PLS PLS HELP PLS PLS PLS HELP PLS HELP PLS BOTH OF THEM PLS

Answers

Answer:

16. Right isosceles

17. D

Step-by-step explanation:

The triangle has a right angle this makes it a right trangle. Also all parallelograms are not squares, all rectangles aren't squares and all parallelograms aren't rhombuses.

16. right isosceles

17. C: all rectangles are squares

Given a random sample of size 22 from a normal distribution, find k such that
(a) P(-1.721 (b) Find P(k (c) Find P(-k

Answers

The required probabilities are:(a) P(-1.721 < Z < k) = P(Z < k) - P(Z < -1.721) = 0.8531 - 0.0429 = 0.8102(b) P(k < Z) = 1 - P(Z < k) = 1 - 0.8531 = 0.1469(c) P(-k < Z) = P(Z < k) = 0.8531.

Given a random sample of size 22 from a normal distribution, the required probabilities are to be found. Therefore, the following is the solution to the problem.

Let X1, X2, ..., X22 be a random sample of size n = 22 from a normal distribution with µ = mean and σ = standard deviation.1. P(-1.721 -1.721).

We can find k using the standard normal distribution table as follows:

Using the table, we find that P(Z < k) = P(Z < 1.05) = 0.8531. Therefore, the value of k is 1.05. Hence, P(-k < Z < k) = P(-1.05 < Z < 1.05) = 0.8531 - 0.1469 = 0.7062. Therefore, the required probabilities are:(a) P(-1.721 < Z < k) = P(Z < k) - P(Z < -1.721) = 0.8531 - 0.0429 = 0.8102(b) P(k < Z) = 1 - P(Z < k) = 1 - 0.8531 = 0.1469(c) P(-k < Z) = P(Z < k) = 0.8531

To know more on normal distribution visit:

https://brainly.com/question/4079902

#SPJ11

The values of k for the given probabilities are as follows:(a) k = 1.72(b) k = 1.96(c) k = -1.645. Given a random sample of size 22 from a normal distribution, to find k we will use the following steps:

Step 1: Write down the given probabilities. Using the standard normal table, we find the following probabilities: P(-1.721  = 0.0426 (rounding off to four decimal places)

Step 2: Find the value of k for (a)We need to find k such that P(-1.721  = 0.0426.From the table, we get the area between the mean (0) and z = -1.72 as 0.0426. Therefore,-k = -1.72k = 1.72Therefore, k = 1.72

Step 3: Find the value of k for (b)We need to find k such that P(k < Z) = 0.975From the standard normal table, we get the area between the mean (0) and z = 1.96 as 0.975. Therefore,k = 1.96Therefore, k = 1.96

Step 4: Find the value of k for (c)We need to find k such that P(-k < Z) = 0.90For a two-tailed test with an area of 0.10, the z-value is 1.645. Therefore,-k = 1.645k = -1.645Therefore, k = -1.645

To know more about probabilities, visit:

https://brainly.com/question/29381779

#SPJ11

X squared minus 3x minus 10 equals 0

Answers

Answer:

The image below explains read for the steps Your Welcome :)

Verify the equation: (sin x + cos x)(tan x + cot x) = sec x csc x

Answers

Answer:

The equation (sin(x) + cos(x))(tan(x) + cot(x)) = sec(x)csc(x) is not solvable because the two sides are not equal.

1.in an electrical circuit the current,I amperes, is directly proportional to the square root of the power,p watts.
I=4 when p=100
A) find an equation connecting I and P.
B) calculate I when P= 144

Answers

Answer:

A for ever I  P=25

b. 5.76

Step-by-step explanation:

What is 12x3 – 9x2 – 4x + 3 in factored form?

(
x2 –
)(
x –
)

Answers

Answer:

(√3·x - 1)(√3·x + 1)(4x - 3)

Step-by-step explanation:

Note that the last two coefficients are -4 and +3, and the associated factor is (4x - 3).

The first two terms are

12x^3 - 9x^2, which become 3x(4x^2 - 3x) through factoring and then 3x^2(4x - 3).  

Therefore, 12x3 – 9x2 – 4x + 3 can be rewritten as:

                   (4x - 3)(3x^2 - 1).  

It's possible to factor 3x^2 - 1, even though 3 is not a perfect square.  Write 3x^2 - 1 as (√3·x - 1)(√3·x + 1)    

Then 12x3 – 9x2 – 4x + 3 = (√3·x - 1)(√3·x + 1)(4x - 3)

Answer:

( 3 x2 –  1 )( 1  ⇒ 4x –  3 )

Step-by-step explanation:

I did it lol

a) Does the following improper integral converge or diverge? Show your reasoning -20 6 re-21 dt (b) Apply an appropriate trigonometric substitution to confirm that L'4V1 –c?dx == 47 7T (c) Find the general solution to the following differential equation. dy (+ - 2) = 3, 1-2, 1 da

Answers

(a) The improper integral ∫[0,∞] [tex](xe^(-2x)dx)[/tex] converges.

(b) To evaluate the integral ∫[0,1] [tex](4\sqrt{1-x^2}dx)[/tex], we can use the trigonometric substitution x = sin(θ).

(c) The general solution to the given differential equation is y = ln|x + 2| - ln|x - 1| + C.

(a) To determine if the improper integral ∫[0,∞] [tex](xe^{-2x}dx)[/tex] converges or diverges, we can use the limit comparison test.

Let's consider the function f(x) = x and the function g(x) = [tex]e^{-2x}[/tex].

Since both f(x) and g(x) are positive and continuous on the interval [0,∞], we can compare the integrals of f(x) and g(x) to determine the convergence or divergence of the given integral.

We have ∫[0,∞] (x dx) and ∫[0,∞] [tex](e^(-2x) dx)[/tex].

The integral of f(x) is ∫[0,∞] (x dx) = [[tex]x^2/2[/tex]] evaluated from 0 to ∞, which gives us [∞[tex]^2/2[/tex]] - [[tex]0^2/2[/tex]] = ∞.

The integral of g(x) is ∫[0,∞] [tex](e^{-2x} dx)[/tex] = [tex][-e^{-2x}/2][/tex] evaluated from 0 to ∞, which gives us [[tex]-e^{-2\infty}/2[/tex]] - [[tex]-e^0/2[/tex]] = [0/2] - [-1/2] = 1/2.

Since the integral of g(x) is finite and positive, while the integral of f(x) is infinite, we can conclude that the given integral ∫[0,∞] ([tex]xe^{-2x}dx[/tex]) converges.

(b) To evaluate the integral ∫[0,1] (4√([tex]1-x^2[/tex])dx), we can make the trigonometric substitution x = sin(θ).

When x = 0, we have sin(θ) = 0, so θ = 0.

When x = 1, we have sin(θ) = 1, so θ = π/2.

Differentiating x = sin(θ) with respect to θ, we get dx = cos(θ) dθ.

Now, substituting x = sin(θ) and dx = cos(θ) dθ in the integral, we have:

∫[0,1] (4√([tex]1-x^2[/tex])dx) = ∫[0,π/2] (4√(1-[tex]sin^2[/tex](θ)))cos(θ) dθ.

Simplifying the integrand, we have √(1-[tex]sin^2[/tex](θ)) = cos(θ).

Therefore, the integral becomes:

∫[0,π/2] (4[tex]cos^2[/tex](θ)cos(θ)) dθ = ∫[0,π/2] (4[tex]cos^3[/tex](θ)) dθ.

Now, we can integrate the function 4[tex]cos^3[/tex](θ) using standard integration techniques:

∫[0,π/2] (4[tex]cos^3[/tex](θ)) dθ = [sin(θ) + (3/4)sin(3θ)] evaluated from 0 to π/2.

Plugging in the values, we get:

[sin(π/2) + (3/4)sin(3(π/2))] - [sin(0) + (3/4)sin(3(0))] = [1 + (3/4)(-1)] - [0 + 0] = 1 - 3/4 = 1/4.

Therefore, the value of the integral ∫[0,1] (4√([tex]1-x^2[/tex])dx) is 1/4.

(c) To find the general solution to the differential equation ([tex]x^2 + x - 2[/tex])(dy/dx) = 3, for x ≠ -2, 1, we need to separate the variables and integrate both sides.

(dy/dx) = 3 / ([tex]x^2 + x - 2[/tex]).

∫(dy/dx) dx = ∫(3 / ([tex]x^2 + x - 2[/tex])) dx.

Integrating the left side gives us [tex]y + C_1[/tex], where [tex]C_1[/tex] is the constant of integration.

To evaluate the integral on the right side, we can factor the denominator:

∫(3 / ([tex]x^2 + x - 2[/tex])) dx = ∫(3 / ((x + 2)(x - 1))) dx.

Using partial fractions, we can express the integrand as:

3 / ((x + 2)(x - 1)) = A / (x + 2) + B / (x - 1).

Multiplying both sides by (x + 2)(x - 1), we have:

3 = A(x - 1) + B(x + 2).

Expanding and equating coefficients, we get:

0x + 3 = (A + B)x + (-A + 2B).

Equating the coefficients of like terms, we have:

A + B = 0,

- A + 2B = 3.

Solving this system of equations, we find A = -3 and B = 3.

3 / ((x + 2)(x - 1)) = (-3 / (x + 2)) + (3 / (x - 1)).

∫(3 / ([tex]x^2 + x - 2[/tex])) dx = -3∫(1 / (x + 2)) dx + 3∫(1 / (x - 1)) dx.

-3ln|x + 2| + 3ln|x - 1| + C2,

where C2 is another constant of integration.

Therefore, the general solution to the differential equation is:

y = -3ln|x + 2| + 3ln|x - 1| + C,

where C = C1 + C2 is the combined constant of integration.

To know more about integral, refer here:

https://brainly.com/question/31059545

#SPJ4

!
A store is selling electronics
and mark up all the prices by
30%. If the store's cost for a
printer is $25, what is the
customer's cost?
בדד
תחזרי

Answers

Answer:

im guessing 32.5$ but i honestly dont know lol

Step-by-step explanation:

simplify the screenshot below

Answers

Answer:

-4x - 16y

Step-by-step explanation:

Given:

-4(3x - 2x + 4y)

Required:

Simplify

Solution:

To simplify, apply the distributive property by multiplying every term that is inside the brackets by -4

Thus:

-4*3x -4*-2x -4*+4y

-12x + 8x - 16y

Add like terms

-4x - 16y

Find integers s, t, u, v such that 1485s +952t = 690u + 539v. b 211, 307, 401, 503 are four primes. Find integers a, b, c, d such that 211a + 307b + 401c + 503d = 0 c Find integers a, b, c such that

Answers

One possible values of the integers is: a = 8020k, b = -10025k, and c = 401k where k is an arbitrary integer.

To find integers s, t, u, v such that 1485s + 952t = 690u + 539v, we can use the Extended Euclidean Algorithm. First, we compute the greatest common divisor of 1485 and 952:

gcd(1485, 952) = gcd(952, 533) = gcd(533, 419) = gcd(419, 114) = gcd(114, 91) = gcd(91, 23) = 23

Using the algorithm, we can write 23 as a linear combination of 1485 and 952:

23 = (-17) * 1485 + (27) * 952

Multiplying both sides by (30), we get:

690 = (-510) * 1485 + (810) * 952

and

539 = (357) * 1485 + (-567) * 952

Therefore,

s = -510u + 357v

t = 810u -567v

where u and v are arbitrary integers.

For the second part of the question, we need to find integers a, b, c, d such that:

211a + 307b +401c +503d =0

One possible way is:

a = -262

b = -169

c = 122

d = 97

To check that this, we substitute these values into the equation:

211(-262) +307(-169) +401(122) +503(97) = -55682 -52083 +51122 +50691 =0

Therefore, this is a valid solution.

Finally, for the third part of the question, we need to find integers a, b, c such that:

690a +539b=401c

Using the Extended Euclidean Algorithm, we can write:

gcd(690, 539) = gcd(539, 151) = gcd(151, 86) = gcd(86, 65) = gcd(65, 21) = gcd(21, 2) = 1

and

1 = (20) * 690 + (-25) * 539

Multiplying both sides by 401, we get:

401 = (8020) * 690 + (-10025) * 539

To know more about arbitrary integer refer here:

https://brainly.com/question/31117845#

#SPJ11

Learning
Diagnostic
Analytics
Recommendations
skill plans
Math
E Standards
Algebra
XS Exponential growth and decay: word problems UKO
If a city with a population of 100,000 doubles in size every 28 years, what will the population
be 56 years from now?

Answers

Answer:

400,000

Step-by-step explanation:

Calculate the doubling time period-

Doubling time period(t)=

doubling time period(t)= 2

Calculate the new population using the doubling time formula below where t is the number of doubling periods:

Population = Initial Population * [tex]2^{t}[/tex]

Population = 100000 * [tex]2^{2}[/tex]

Population = 100000 * 4

2 7/9 × 1 1/5 ÷ 2 1/2

Answers

Answer

5/36 ([tex]\frac{5}{36}[/tex])

Answer:

22/35

Step-by-step explanation:

27/9 = 3

3 × 11/5 ×2/21

=22/35

A researcher believes that a new training program will increase test scores. Previous research shows that test scores increase 8 points between the first and second administration of the test being used. This researcher believes his training program will cause a significant increase, beyond the expected 8 points. If a paired-samples t test is used by this researcher, what value would he expect to be at the center of the comparison distribution, a distribution of mean differences

Answers

Answer:

value = 8

Step-by-step explanation:

when a paired-samples t test is used by this researcher we will write out the hypothesis as follows

H0: μd ≤ 8  ( null )

Ha: μd >  8 ( alternate )

Given the above Hypothesis

If a paired-sample T test is used by the researcher  the value that would be at the center of the comparison will be 8

Which number line shows 1.5 graphed?

Answers

Answer:

The third one down

Step-by-step explanation:

Other Questions
A nurse is administering medications and fluids intravenously to a pediatric patient. which must the nurse do to prevent complications? Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 and CH3CH2CH(CH3)CH2CH2CH3. CH3CH(CH3)CH2CH2CH(CH3)CH3 and CH3CH2CH2CH2CH2CH2CH2CH3. CH3CH(CH3)CH2CH3 and CH3CH2CH2CH2CH3 Which of the following is a task that is not performed by the kernelof an operating system?A. Avoid deadlockB. Schedule processesC. Allocate resourcesD. Install a software package Quatro Company issues bonds dated January 1, 2021, with a par value of $400,000. The bonds' annual contract rate is 13%, and Interest is paid semiannually on June 30 and December 31. The bonds mature When confronted about possible racial discrimination, the management at WeServe, Inc. pointed to a company- wide effort that started about 2 1/2 years ago. This effort was aimed at hiring and training more minority employees. We will explore that idea in this problem.a) Consider only the minority employees. Construct a 95% confidence interval for the average tenure of all minority employees. Round your confidence interval limits to the nearest hundredth. Use a fixed-point iteration to find a solution to within 10-2 for 23 - 2-1 = 0 on [1, 2]. Use po = 1. Use two different representations g(x) = r. For each case show the number of iterations and the value of approximate solution for each iteration. Compute the convergence factor k in both cases. why were scientists unconcerned about the factors that were not accounted for in their estimation of the volume of oil spilled? Chicken pox is viewed as a lifelong disease that produces different manifestations at different ages. This is an example of which of the following uses of systems analysis In order to get an object moving, you must push harder on it than it pushes back on you. O True O False The Schoch Museum is embarking on a five-year fundraising campaign. As a nonprofit institution, the museum finds it challenging to acquire new donors, as many donors do not contribute every year. Suppose that the museum has identified a pool of 10,000 potential donors. The actual number of donors in the first year of the campaign is estimated to be 65% of this pool. For each subsequent year, the museum expects that 25% of current donors will discontinue their contributions. In addition, the museum expects to attract some percentage of new donors. This is assumed to be 8% of the pool. The average contribution in the first year is assumed to be $60, and will increase at a rate of 3.5%. Develop a model to predict the total funds that will be raised over the five-year period. Schoch Museum Donor pool First year percentage Annual percentage leaving Annual percentage new Annual contribution increase 10000 65% 25% 8% 3.5% 1 2 3 4 5 Year Number of donors Average contribution Total donation Cumulative funds raised 2 PointsWhich of these is the best example of fragmentation?OA. A story that starts at the end and moves backwardORB. A story that starts with the climaxOc. A story told chronologicallyOD. A story that ends with a resolution 10.8 Accounting by lessee and lessor On 1 July 2020, Sherlock Ltd leased a processing plant to Holmes Ltd. The plant was purchased by Sherlock Ltd on 1 July 2020 for its fair value of $467 112. The lease agreement contained the following provisions. LO3, 5 Lease term Economic life of plant Annual rental payment, in arrears (commencing 30/6/21) Residual value at end of the lease term Residual guaranteed by lessee Interest rate implicit in lease The lease is cancellable only with the permission of the lessor. 3 years 5 years $150 000 $90000 $60 000 7% Holmes Ltd intends to return the processing plant to Sherlock Ltd at the end of the lease term The lease has been classified as a finance lease by Sherlock Ltd. Required 1. Prepare: (a) the lease payments schedule for Holmes Ltd (show all workings) (b) the journal entries in the records of Holmes Ltd for the year ended 30 June 2022. 2. Prepare: (a) the lease receipts schedule for Sherlock Ltd (show all workings) (b) the journal entries in the records of Sherlock Ltd for the year ended 30 June 2022. itTopic Test: Early Civilizations of ChinaBy what means did Zhou rulers keep control over all the different regions of their kingdom?OA by keeping a strong army ready to put down any rebellionOB.by treating the people with kindness and respectC.by starting a civil service based on the ideas of ConfuciusOD. by putting family members in charge of individual regionsqqqqq Tom's utility of wealth function is given by the following quadratic function.: U(x)=0.5(x5)2, for x5.Tom must invest his wealth x in 2 independent risky assets, A and B. Asset A has an expected value of A =2 and variance A2 =1. Asset B has an expected value of B =3 and a variance B =3. Tom wants to maximize his expected utility.a. What is Tom's expected utility if he invests only in Asset A or if he only invests in Asset B?b. Which fraction k of his wealth should Tom optimally invest in Asset A (also, which fraction 1 in Asset B)? Then, what is his expected utility? the equilibrium constant for the following reaction is 1.5108 at 25c . n2(g) 3h2(g)2nh3(g) the value of g for this reaction is ________ kj/mol Smith says that monopolizing the home market by regulating against imports or foreign direct investment is: O A. More helpful to foreign countries than to the home country B. Not typically helpful to the home country C. Necessary for a higher GDP for the home country O D. Necessary in creating greater individual wealth O E. Both C and D Which of the means of moneymaking does Aristotle dislike the most? OA. Sales of shoes for exchange B. Usury and reselling OC. Sales of primary goods D. Sales of shoes E. Both B-and C Aristotle's upset over Thales' olive press strategy derives mostly from: O A. The fact that Thales felt the need to get rich rather than to remain a philosopher B. The fact that Thales lied to the rich olive growers to get rich C. The fact that Thales employed monopolistic practices to get rich D. A and B E. B and C at is correct or incorrect for the work you have completed so far. It does not indicate completic FinCorp's free cash flow to the firm is reported as $250 million. The firm's interest expense is $31 m Suppose that the Winder Recreational Vehicle Company has three plants where campers are produced. The campers are then shipped to four main suppliers. The unit costs, suppliers, and demands are shown in Table R8.1. There also exist set up costs for each plant. These are: Winder $1,000 Douglas 750 Rome 1,250 Table R8.1. Winder Recreational Vehicle Company Distributor Plant Atlanta Chicago New York Los Angeles Campers Available Winder 50 100 125 200 80 Douglas 125 125 175 50 Rome 25 75 100 150 80 Campers Demanded 25 35 45 15 These costs must be paid if any campers are shipped from the plant. Given this information, what is the likely objective? Solve using LINGO. (45) 75 Create a table variable using data in the dbo.HospitalStaff table with the following 4 columns a. Name Located in the NameJob Column : Everything before the _ b. Job Located in the NameJob Column : Everything after the _ c. HireDate d. City Located in the Location Column: Everything before the Assume that a undirected graph G that has n vertices within it adjacency matrix is given. (1) If you need to insert a new edge into the graph, what would be the big O notation for the running time of the insertion ? Please write the answer in term of a big O notation. Ex: If the correct answer is n!, write O(n!) (2) If you need to insert a new vertex into the graph, what would be the big O notation for the running time of the insertion ?Please write the answer in term of a big o notation. Ex: If the correct answer is n!, write O(n!)