If you apply the changes below to the quadratic parent function, f(x) = x², which of these is the equation of the new function? Shift 1 unit right. • Vertically stretch by a factor of 3. • Reflect over the x-axis. A. g(x)=-3(x-1)2 B. g(x)=-3(x+1)2 c. g(x)=-3x²-1 D. g(x) = (-3x+1)2​

Answers

Answer 1

Equation of the new function -3(x+1)².

The correct option is (B)

What is function?

An expression, rule, or law that defines a relationship between one variable (the independent variable) and another variable (the dependent variable).

Given function:

f(x) = x²

The given condition are shift one unit right+ 1.

i.e., x+1

Vertically stretch 3 units= -3

i.e., -3(x+1)

So, reflect over x- axis = square the function'

So, new function= -3(x+1)²

Learn more about function here:

https://brainly.com/question/12431044

#SPJ1


Related Questions

what is the sum of the ten thousand digit and the million's digit of 1,234,567,890

Answers

Answer: The ten thousand digit is 6.  And the millions digit is 4. So the answer is 10.

Which of the following shows the correct steps to find the value of 27 to the power of 1 over 3 ? (1 point)

A. 27 to the power of 1 over 3 equals 9 to the power of 3 to the power of 1 over 3 equals 9 to the power of 3 multiplied by 1 over 3 equals 9

B. 27 to the power of 1 over 3 equals 3 to the power of 9 to the power of 1 over 3 equals 3 to the power of 9 multiplied by 1 over 3 equals 3

C. 27 to the power of 1 over 3 equals 3 to the power of 4 to the power of 1 over 2 equals 3 to the power of 4 multiplied by 1 over 2 equals 9

D. 27 to the power of 1 over 3 equals 3 to the power of 3 to the power of 1 over 3 equals 3 to the power of 3 multiplied by 1 over 3 equals 3

Answers

Answer:

D

Step-by-step explanation:

it shows the correct one

Find the area of the blue region.
10 m
5.5 m
4m
A. 40 m²
B. 26.5 m²
C. 48 m²
D. 70 m²
7m

Answers

Answer:

the answer is 48m²

Step-by-step explanation:

mark me brainlist please!!

An oblique cylinder has a radius of 9 centimeters and a volume of 486 cubic centimeters. Use Cavalieri’s Principle to calculate the height of the solid.

6 meters
5 meters
8 meters
7 meters

Answers

Using Cavalieri’s Principle, the height of the oblique cylinder with the given volume and base radius is 6cm.

Option A) is the correct answer.

What is the height of the oblique cylinder?

From Cavalieri's principle, the volume of an oblique cylinder is expressed as;

V = base area × h

V = πr² × h

Given that;

Radius r = 9cmVolume of the oblique cylinder V = 486πcm³Height of the oblique cylinder h = ?

V = πr² × h

486πcm³ = π × ( 9cm )² × h

486πcm³ = π × 81cm² × h

486πcm³ = 81πcm² × h

h = 486πcm³ / 81πcm²

h = 6cm

Using Cavalieri’s Principle, the height of the oblique cylinder with the given volume and base radius is 6cm.

Option A) is the correct answer.

Learn more on volume of cylinder here: brainly.com/question/16788902

#SPJ1

The hour and minute hands of a clock form an angle that constantly changes. During each hour of the day, the clock hands will form right, acute, and obtuse angles. Assume the hour hand points directly at the hour.Write a time of day when the two clock hands form each type of angle

Answers

The each type of angle are discussed below

What is angle?

An angle is formed when two straight lines or rays meet at a common endpoint. The common point of contact is called the vertex of an angle.

If the hours hand point to the hour 1 and minute hand at 12 then

angle will be acute.

If the hours hand point to the hour 2 and minute hand at 12  then

angle will be acute.

If the hours hand point to the hour 3 and minute hand at 12  then

angle will be right angle .

If the hours hand point to the hour 4 and minute hand at 12  then

angle will be obtuse.

If the hours hand point to the hour 5 and minute hand at 12  then

angle will be obtuse.

If the hours hand point to the hour 6 and minute hand at 12  then

angle will be straight angle .

If the hours hand point to the hour 7 and minute hand at 12  then

angle will be reflex.

If the hours hand point to the hour 8 and minute hand at 12  then

angle will be reflex.

If the hours hand point to the hour 9 and minute hand at 12  then

angle will be reflex.

If the hours hand point to the hour 10 and minute hand at 12  then

angle will be reflex.

If the hours hand point to the hour 11 and minute hand at 12  then

angle will be reflex.

If the hours hand point to the hour 12 and minute hand at 12  then

angle will be Complete angle.

Learn more about angle here:

https://brainly.com/question/12129157

#SPJ1

1.
Which of these is equivalent to
A. 2-19
1
B.
27
1
C.
2
23
D.
(2-4)²x2-5
2-6
-?

Answers

The solution to the given indices are 1/2^7, 11^4 and -1/64

Indices expression

Give the following indices expression

[tex]\frac{(2^{-4})^2\times 2^{-5}}{2^{-6}} \\[/tex]

This can be further simplified according to the law of indices as:

[tex]\frac{(2^{-4})^2\times 2^{-5}}{2^{-6}} =\frac{2^{-8-5}}{2^{-6}}[/tex]

Determine the result

[tex]\frac{2^{-8-5}}{2^{-6}} = 2^{-7} = 1/2^7[/tex]

For the indices expression

[tex]11^{-4}\times 11^{8} = 11^{-4+8}=11^4[/tex]

For the indices expression

[tex]-4^4\times4^{-7}\\=-(4^{4-7})\\= -4^{-3}\\=-1/4^3\\=-1/64[/tex]

Hence the solution to the given indices are 1/2^7, 11^4 and -1/64

Learn more on indices here: https://brainly.com/question/170984

#SPJ1

Solve for x. Round your answer to the nearest tenth if necessary. Figures are not necessarily drawn to scale.

Answers

Answer: 13.3

Step-by-step explanation:

Since angles in a triangle add to 180 degrees, we know that in triangle UWV, [tex]m\angle U=50^{\circ}[/tex]. Thus, the triangles are similar by AA.

Since corresponding sides of similar triangles are proportional,

[tex]\frac{x}{24}=\frac{20}{36}\\x=(20/36)(24)=\boxed{13.3}[/tex]

Whoever answers correctly gets 100 points and BRAINLIEST
Item 18
A trash can is shaped like a right rectangular prism. It has a base area of 3 square feet and a height of 314 feet.

What is the volume of the trash can?

4 7/8 ft³

6 1/4ft³

9 3/4ft³

12 1/2 ft³

Answers

Answer:

I think you may have made a typo, as it is extremely unlikely that a trashcan is 314 feet tall.  I will assume that you meant 3.14 feet.

Step-by-step explanation:

We already have the base, so we can already cut out one step.  If we were not given the base, however, we would simply multiply the length by the width of the prism.  Next we multiply the base by the height (3 X 3.14) to get the volume of the prism, 9.42 cubic feet.  In the case that there was no typo, and 314 was the correct height, the volume would be 942 cubic feet.

Volume

Base area×Height3×314942ft³

But unfortunately there is no option Present .

Let's correct question

make height =3.14ft

Volume=

9.42ft

Some how nearly present is 9-3/4 ft³ i.e 9.75ft³

Is 10h - 10 equal to10 - 10h

Answers

Answer:no

Step-by-step explanation:

it’s equal to -10 + 10h by the commutativity of addition and subtraction

Please help i been asking since yesterday
Calculate the perimeter of the triangle for problems

B. Calculate the area of the triangle for problems

Answers

Answer:

To calculate the perimeter of a triangle, add the length of its sides. For example, if a triangle has sides a, b, and c, then the perimeter of that triangle will be P = a + b + c.

Answer:

1) 21.24cm

2)19.8ft

3)22.84mm [2.284cm]

Step-by-step explanation:

To calculate the perimeter of a triangle, add the length of its sides.

1) perimeter = 5.4+8.84+7

=>    5.4+8.84+7 = 21.24,

 21.24cm

2) perimeter = 6.6 + 6.6 + 6.6  i.e  6.6* 3

=>    6.6 x 3 = 19.8

 19.8ft

3) perimeter = 8.3 + 4.9 + 9.64

=>     8.3 + 4.9 + 9.64 =  22.84

22.84mm or 2.284cm

AREA

1) it's a right triangle,

 =>    Area of a right triangle = 1/2 × base × height.

 =>    here, base is a and height is b

 =>    a = 7, b = 5.4

 =>   now we multiply it,  

 => 7*5.4 = 37.8

 => now multiply it with 1/2,  

 => 1/2 x 37.8 =  37.8/2

 => 37.8/2  = 18.9

 

2) it's an equilateral triangle,

18.8620

the formula is  √3 a^2/ 4

=>    √3* 6.6^2/ 4  

=>    75.4481/4 = 18.8620

3)  20.335

    base = a = 8.3

    height = b = 4.9

=>    8.3 * 4.9 = 40.68

=>     40.68/2 = 20.335

hope this helps:)

will get brainliest if answered right. no smart remarks

Answers

Answer:

A.g, a.f ,a.b

Step-by-step explanation:

a number, n is multiplied by -5/8 the product is -0.4 how would you set this up to solve

Answers

The value of n in the mathematical statement is 0.64

How to solve the equation?

The statement is given as:

n multiplied by -5/8 equals -0.4

Rewrite properly as:

n * -5/8 = -0.4

Multiply both sides by -1

n * 5/8 = 0.4

Multiply both sides by 8/5

n = 0.64

Hence, the value of n in the mathematical statement is 0.64

Read more about mathematical statements at:

https://brainly.com/question/4344214

#SPJ1

find x in this two examples

Answers

The values of x in both figures are 45 and 34, respectively.

The value of x in (a)

Start by calculating the angle CAB using:

CAB + ABC + BCA = 180 --- angles in a triangle

The triangle is an isosceles triangle.

So, we have:

CAB + ABC + CAB = 180

Evaluate

2CAB + 25 + 75 = 180

This gives

CAB = 40

Calculate angle BEA using:

BEA + CAB + ABE = 180 --- angles in a triangle

This gives

BEA + 40 + 25 = 180

Evaluate

BEA = 115

Vertical angles are equal.

So, we have:

CED = BEA = 115

Calculate angle EDC using:

EDC + CED + DCE = 180 --- angles in a triangle

This gives

EDC + 115 + 30 = 180

Evaluate

EDC = 35

Opposite angles of quadrilaterals add up to 180.

So, we have:

x + EDC + ABC = 180

This gives

x + 35 + 25 + 75 = 180

Evaluate

x = 45

Hence, the value of x is 45

The value of x in (b)

Start by calculating the angle DEC using:

DEC + CDE + EED = 180 --- angles in a triangle

This gives

DEC + 18 + 30 = 180

Evaluate

DEC  = 132

Vertical angles are equal.

So, we have:

AEB = DEC = 112

Calculate angle EAB using:

EAB + AEB + ABE = 180 --- angles in a triangle

This gives

EAB + 112 + 42  = 180

Evaluate

EAB  = 26

Triangle ABC is an isosceles triangle.

So, we have:

BCE = EAB  = 26

Calculate angle CBE using:

CBE + BCE + CEB = 180 --- angles in a triangle

Where CEB = 180 - DEC --- angle on a straight line

So, we have:

CBE + BCE + 180 - DEC = 180

This gives

CBE + 26 + 180 - 112 = 180

Evaluate

CBE  = 86

Opposite angles of quadrilaterals add up to 180.

So, we have:

x + EDC + ABC = 180

This gives

x + 18 + 42 + 86 = 180

Evaluate

x = 34

Hence, the value of x is 34

Note that the figures are labeled to ease explanation (see attachment)

Read more about quadrilaterals at:

https://brainly.com/question/5715879

#SPJ1

PLEASE HELP!
Stephanie is running a 5K race. She wants to keep track of her time and her distance throughout the race. Identify the independent and dependent variable.
A. The independent variable is the length of the race. The dependent variable is the time.
B. The independent variable is the time. The dependent variable is the distance of the race.
C. The independent variable is the time. The dependent variable is Stephanie's distance.
D. The independent variable is Stephanie's distance. The dependent variable is the time.

Answers

Answer:

A

Step-by-step explanation:

It mentions she is running a 5K race. That means the distance of the race is fixed and will not change. That means :

Length of the race is the independent variable and the dependent variable is time.

Answer:

The correct answer is letter A

What is the slope of the line graphed below ? (3, 5); (0, 1); m = A 1/3 B. 3 C. - 3; - 1/3

Answers

Answer:

4/3 = m

Step-by-step explanation:

Since you have been given the value of two points, you can use the point-slope formula to find the slope. This general structure of this formula is:

y₁ - y₂ = m(x₁ - x₂)

In this equation, "m" represents the slope, "y₁" and "x₁" represent the values in the first point, and "y₂" and "x₂" represent the values in the second point,

To find the slope, substitute the values of each point into the formula and simplify.

Point 1: (3, 5)

Point 2: (0, 1)

y₁ - y₂ = m(x₁ - x₂)                  <----- Point-slope form

5 - y₂ = m(3 - x₂)                   <----- Plug values from Point 1 into equation

5 - 1 = m(3 - 0)                      <----- Plug values from Point 2 into equation

4 = m(3 - 0)                           <----- Simplify left side

4 = m(3)                                 <----- Simplify inside the parentheses

4/3 = m                                  <----- Divide both sides by 3

I am almost certain that my math is correct, yet my answer does not match any of the answers given. Perhaps I have been given the wrong points? For instance, the answer would be A.) if the value of Point 2 was (0,4).

THIS IS ALGEBRA 2 CAN ANYONE SOLVE IT FOR ME?

Answers

Answer:

(a)  128 ft

(b)  4 s

(c)  Vertex:  (1, 144)

Step-by-step explanation:

Given information:

h(t) = height in feett = time in seconds after the launch

Part (a)

The height of the projectile at launch is the value of h(t) when t = 0 (the y-intercept).

Therefore, from inspection of the graph, the y-intercept is (0, 128).

So the height of the projectile at launch is 128 ft.

Part (b)

The length of time it took for the projectile to land is the time from the beginning (when t = 0) to when the height is 0 (the x-intercept).  

From inspection of the graph, the x-intercept is (4, 0)

So the length of time it took for the projectile to land is 4 s.

Part (c)

The vertex is the turning point (minimum/maximum point).

Therefore, from inspection of the graph, the vertex is (1, 144).

The vertex represents the time and height at which the projectile was at its maximum.  So at the time of 1 second, the projectile was at its maximum height of 144 ft.

The tree diagram represents an
experiment consisting of two trials.

Answers

Answer:

P(D) = 0.65

Step-by-step explanation:

it's like following a path on map

each line is like a street length

First, it's 0.5 to A and then 0.6 to D.

Then, it's 0.5 to B and 0.7 to D.

P(D) = (0.5 times 0.6) + (0.5 times 0.7) =

P(D) = 0.30 + 0.35 = 0.65

A tree diagram is simply a way of representing a sequence of events.

Tree diagrams are particularly useful in probability since they record all possible outcomes in a clear and uncomplicated manner.

like chance of getting heads or tails on coin flips

https://brainly.com/question/16128824

nrich.maths.org

math is fun

I need the answer please!!!!

Answers

Answer:

53712.4

Step-by-step explanation:

10^3 = 1000

To multiply a decimal by 1000, move the decimal point in the multiplicand by three places to the right.

so, 53.7124 becomes 53712.4

hope this helps :)

Which of the following tables represent a function?

A.
X 3 3 4 4
Y 2 -2 3 -3

B.
X 5 -5 5 -5
Y 2 2 8 8

C.
3 3 5 5
Y 4 5 6 7

D.
X 4 -4 5 -5
Y 2 2 3 3

Answers

The 2 because I am goated

Step-by-step explanation:

what is an arithmetic pattern

Answers

The arithmetic pattern is also known as the algebraic pattern. In an arithmetic pattern, the sequences are based on the addition or subtraction of the terms. If two or more terms in the sequence are given, we can use addition or subtraction to find the arithmetic pattern.

State the values of the angles below:
i) acute ∠AOB=
ii) acute ∠COD=
iii) acute ∠BOC=
iv) acute ∠AOD=

Answers

The values of the angles are

i) acute ∠AOB = 10°

ii) acute ∠COD = 25°

iii) acute ∠BOC = 40°

iv) acute ∠AOD = 75°

Calculating the measured of angles

From the question, we are to determine the measures of the angles

i) acute ∠AOB

From the given diagram,  

∠AOB = 10°

ii) acute ∠COD

From the given diagram,  

∠COD= 25°

iii) acute ∠BOC

From the diagram, we can write that

∠AOB+∠BOC+ ∠COD + ∠DOE = 90° (Angles at a right angle)

10° + ∠BOC + 25° + 15° = 90°

∠BOC + 50° = 90°

∠BOC = 90° - 50°

∠BOC = 40°

iv) acute ∠AOD

From the diagram,

∠AOD = ∠AOB + ∠BOC +∠COD

∠AOD = 10° + 40° + 25°

∠AOD = 75°

Hence, the values of the angles are

i) acute ∠AOB = 10°

ii) acute ∠COD = 25°

iii) acute ∠BOC = 40°

iv) acute ∠AOD = 75°

Learn more on Calculating measures of an angle here: https://brainly.com/question/26354356

#SPJ1

please help me with these questions????​

Answers

5: THEO = what should happen
EXP = Wha actually happens.

divide $8 in the ratio 2:3​

Answers

Answer:

3.2$ and 4.8$

Step-by-step explanation:

divide $8 in the ratio 2:3​

8 : (2 + 3) = 1.6 (unity)

1.6 * 2 = 3.2 (ratio2)

1.6 * 3 = 4.8 (ratio 3)

----------

3.2 + 4.8 = 8

the answer is good


Click on the solution set graphic until the correct one is displayed.

Answers

The given graph has no element in its solution set

How to determine the solution set?

The given graph represents the graph of two different linear equations.

From the graph, we can see that both lines are parallel.

Parallel lines have no point of intersection.

And as such they do not have a solution

Hence, the given graph has no element in its solution set

Read more about linear graphs at:

https://brainly.com/question/4025726

#SPJ1

We write the integers from 1 to 150 inclusive. What is the total number of digits that must be written?

Answers

Answer:

342

Step-by-step explanation:

First, there are 9 one-digit numbers, so 9x1=9. Next, there are 90 two-digit numbers, so 90x2=180. There are 51 numbers between 100-150, so 51x3=153. Now, we do 9+180+153=342 digits.

Answer:

Step-by-step explanation:

Solution

Break the numbers down by the number of digits in that sequence.

Number of digits 1 to 9 =                                        9

Number of digits from 10 to 99

There are 90 numbers between 10 and 99

Each has 2 digits

The total number of digits is                               180

Number of digits from 100 to 150

There are 51 numbers between 100 and 150

Each has 3 digits

The total number of digits = 3*51                       153     Add

Total number of digits =                                      342

Answer: 342


Your school has a massive gym. It is 16 feet by 24 feet. You
want to figure out how many stations for the fundraiser you
can have. All the tables are squares but come in different
styles. What is the greatest square table you can use?

Answers

The greatest square that the gym would be able to use is the one that is of 19.6sq/m

How to solve for the square

The area of a triangle = L*W

= 24 * 16

= 384

To get the greatest square that can be gotten from the size of the gym would be

√384 = 19.6

Hence we can conclude that the greatest square table that can be used is 19.6 feet

Read more on area of a square here:

https://brainly.com/question/11444061

#SPJ1

A computer randomly picks a number from the group 20, 21, 22, 23, 24, 25, 26, 27. What is the probability the number is greater than 24 or less than 21?

Answers

Answer:

The answer you're looking for is .5

Step-by-step explanation:

Cause 20 is less than 21, and 25, 26, and 27 is larger than 24, and that's 4 numbers. There's 8 numbers in total, so your answer is 4/8. Divide that by 4, and you get 1/2. That's 50%, if you're thinking out of "1" then it would be ".5"

Answer: 0.5 or 50%

Numbers-Set {20, 21, 22, 23, 24, 25, 26, 27}

Total outcomes: 8

numbers greater than 24 are 25, 26, 27 - 3 numbers

number less than 21 is 20 - 1 number

Total favorable outcomes: 3 + 1 = 4

Probability = favorable outcomes/total outcomes = 4/8 = 0.5


Carlos has at most $40 to spend on food for a barbeque. He wants to buy hot dogs and hamburgers and then
Alls for each. Carlos has already spent $31.50 on the hot dogs and hamburgers. Let r represent the amount of
noney that Carlos can spend on the rolls.
Write and solve an inequality.

Answers

Answer:

$8.50

Step-by-step explanation:

I don't know what Alls are, but if Carlos insists, we can calculate how much he can spend on Alls with the expression:

($31.50) + r [tex]\leq[/tex] $40

This says the sum of what Carlos has already spent (hot dogs and hamburgers) plus the amount he spends on Alls (rolls?), r,  must be equal to or less than the $40 he has allowed himself to spend.

($31.50) + r [tex]\leq[/tex] $40

r  [tex]\leq[/tex] $40 - $31.50

r [tex]\leq[/tex] $8.50

solve pls brainliest

Answers

Answer:

c = 22 (= -18)c = 23 (< -18 because - goes down).4 - c ≤ -18

Step-by-step explanation:

Solve for 1st answer:

4 - c = -18= 4 - 22 = -18= 0 - 18 = -18 (Basically subtract 4 from 22)= -18c = 22

Solve for 2nd answer:

4 - c < -18= 4 - 23 < -18= 0 - 19 < -18= -19c = 23

Actual answer:

4 - c ≤ -18.

A jeweler wants to combine a 60% gold alloy with a 20% gold alloy to make 1000 grams of 50% gold alloy. How many grams of 60% alloy should be used?

Answers

Answer:

750 grams of 60% alloy

Step-by-step explanation:

Define x = amount of 60% alloy and y = amount of 20% alloy

Equating the amounts of gold:

0.6x+0.2y = 1000(0.5)

Since there must be 1000 grams total:

x+y = 1000

Writing the 2 resulting equations together:

0.6x + 0.2y = 500

x + y = 1000

Multiply the first equation by 5:

3x + y = 2500

x + y = 1000

Subtracting the 2nd equation from the 1st:

2x = 1500

x = 750

Answer: 750 grams of 60% alloy

Other Questions
A researcher wishes her patients to try a new medicine for depression. how many different ways can she select 5 patients from 50 patients? a. 1.2K =what is the ohms It cost Makayla $2.80 to send 28 text messages. How much would it cost to send 163 text messages? All aspects of the Kirby-Bauer test are standardized to assure reliability. What might be the consequence of pouring the plates 2mm deep instead of 4mm deep please help Which statement is true about a nickel-cadmium dry cell?The anode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+2OHCd(OH)2+2e.The cathode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+NiO2+2H2OCd(OH)2+Ni(OH)2. A die has six sides, with the numbers 1, 2, 3, 4, 5, and 6. What is the probability of rolling a number greater than 2? Rachel rides her bike due east at 9 miles per hour. Amos rides his bicycle due north at 12 miles per hour. If they left from the same point at the same time, how far apart will they be in 1 hour? Geometry and measurement :))) help please. In a city, the distance between the library and the police station is 3 miles less than twice the distance between thepolice station and the fire station. The distance between the library and the police station is 5 miles. How far apartare the police station and the fire station?O 1 mileO 3 milesO4 milesO6 miles The probability of rain on the last day of July is 95 % . If the probability remains constant for the first seven days of August , what is the probability that it will rain at most two of those seven days in August ? Find the Mean , Standard Deviation , and Variance . If you wanted to make the graph of y=3x+1 steeper which equation could you use PLSS ANSWER MY QUESTION IN THE PICTURE NONSENSE ANSWER REPORT WRONG ANSWER REPORT CORRECT ANSWER brainlist or follow The number scale used on this map is 1:10 000 000 explain what this scale means? 7. The perimeter of a circle of diameter 10 cm is- (a) 30.4 cm. (b) 30.14 cm (c) 31.4 cm. (d) 30.01 cm.(Take = 3.14) a trophic pyramid for southern lake michigan coastalplease answer it Which function has the greater slope and what does it represent? the in-line skate function has the greater slope, which shows that the cost per hour is greater than that of the bicycles the in-line skate function has the greater slope, which shows that the cost per hour is less than that of the bicycles. the bicycle function has the greater slope, which shows that the cost per hour is greater than that of the in-line skates. the bicycle function has the greater slope, which shows that the cost per hour is less than that of the in-line skates. SUPER EASY POINTS, i also need some clarification on this question... would i be correct? Construction This section of a concrete skateboard ramp has the shape of a triangular prism. Find the volumeof the triangular prism. Find the value of the concrete used in the ramp if the cost of concrete is $4.00 per cubicfoot. 1Collin is writing a compare and contrast paragraphabout different language courses offered at his school.Point: English is the most common language in theUnited States, but people also speak French andSpanish.Illustration: More than 37 million people over the ageof five speak Spanish in the U.S., and approximately 2million people speak French.seReport 05 pdfLOType here to searchOiiC1023567Based on the point and illustration, which is the bestexplanation or analysis of the evidence?Spanish classes are more difficult than Frenchclasses.Spanish classes are more interesting than Frenchclasses.Spanish would be more limiting for students thanFrench.O Spanish would be more useful for students ineveryday life.60F Mostly clear AD.6 At a beauty supply company, an employee created a popular line of lip balm, lip gloss, and lipstick after many hours of research and discussions with experts. Now, with their manager's encouragement, they frequently conduct workshops for other employees about lip color and other beauty products. In this scenario, which feature of the company is exemplified How did the views of Woodrow Wilson and his European allies differ at the Conference of Versailles? (Site 3)