is often in the news, the opposite extreme can also lead to globa
henomenon known as La Niña is an extreme cooling of the Pacific
iña, cooler water stretches across the Pacific Ocean all the way to
d La Niña events can have far-reaching effects such as; intense ra
e droughts, and increased number of winter storms in many areas
Il-In" questions below using information from above,
is the oceanic occurrence of warming the Pacific Ocean.
ds for
urs in the
Ocean,
acific Ocean equatorial currents flow in a
direction
is the process of bringing cooler water up to the ocean surf
ENSO stands for?

Answers

Answer 1

Answer:

if you have ah party wen we are pouring for the house and I


Related Questions

Why do you think that carbon spends so much time in this place?

Answers

Answer:

b

Explanation:

ur momjabgdoajn Lahr o the. and dobby the

In a population of plants used to large amounts of rain, one plant is specially adapted to survive on small amounts of water. What would happen if there was a season with little rainfall?
A. All of the population would die off and make room for a new species of plants.
B. The population would be unaffected and would survive and reproduce normally.
C. The adapted plant would survive and reproduce, and others would die causing evolution.​

Answers

The adapted plant would survive and reproduce, and others would die causing evolution.​ thus option C is correct.

What is evolution?

Even though it has resulted in their distinctions, evolution is a biological phenomenon that affects all living things. The fossil record, comparative studies of structure and function, embryological development, and studies of DNA and RNA have all provided evidence to support the hypothesis of evolution.

Plant adapted themselves according to environmental conditions. In water scarcity conditions, plant changes their leaf structures in the thorns to reduce transpiration or stem become storage organ for water.

Learn more about evolution here:

https://brainly.com/question/13326304

#SPJ1

9. What part of the body covers the windpipe when you swallow?
O tongue
O epiglottis
O bronchi
O diaphragm

Answers

Answer:

epiglottis

Hope it helps:)

Answer:

B. epiglottis

Explanation:

this is the part of your body that covers the windpipe when you swallow.

Your body's internal feedback loops work by responding to

Answers

 keep systems functioning near a set point, or ideal level

A genetic problem caused by an issue in the organizms gene's

Answers

Answer:

A genetic problem caused by an issue in the organisms gene's is called genetic disorder.

A genetic disorder is a disease that is caused by a change, or mutation, in an individual's DNA sequence. A genetic disorder is an illness caused by changes in a person's DNA.

A genetic disorder happens when a gene (or genes) has a problem with its code, and this causes a health problem

Matter takes up space and has mass or weight.
True
False

Answers

Answer:

Explanation:All matter has mass and occupies space. All physical objects are made of matter. Matter itself is composed of tiny building blocks known as "atoms".

1. Read each question carefully. Write the letter of the correct answer in you paper. 1. Which of this is made up of smallest particles of rocks which contain decayed matter of plants and animals? A. Land B. Soil C. Mineral D. Water 2. How many types of soil are there? A. 2 B. 1 C. 3 D. 4 3. Which soil holds much water? ABU A. Loam B. Clay C. Sand D. silt I-19 4. Why is soil important to living things? Because it 3 A. forms part of the earth where animals live. B. provides the necessary nutrients needed by plants. C. serves as a place where people live. D. all of the above. 5. Which of the soil type is good for making pots? A. Clay B. Loam C. Soil D. silt 6. How does decayed organism like plants and animals make soil fertile? A. change its color C. makes the texture finer B. enhances color D. add nutrients to the soil 7. What type of soil do you usually expect in a shoreline? A. Clay B. Loam C. Sand D. A and C 8. In which layer of the soil do we usually find loam? A. Topsoil C. Bedrock B. Parent soil D. Ground soil Fill in th​

Answers

1.Thus, the correct option is B.  Soil is made up of the tiniest rock particles that include decomposed plant and animal debris.

2. Thus, the correct option is D. There are 4 types such as:

Sand: Sand is a type of rock formation. A sand can't hold a plant since it can't hold enough water for its roots to drink, and it also lacks the nutrients that a plant needs to thrive.Silt. This sort of soil is generally found around sources of water. This sort of soil is made up of sand and mineral particles, and it can help boost fertility.Clay: A soil in which the particles are closely packed. When moist, this type of dirt becomes extremely sticky and can be molded into any shape. When it dries, it becomes smooth and returns to its original shape.Loam: The most suitable soil for a plant. This dirt is a mixture of all three types of soil. Its ability to hold water and nutrients makes it ideal for storing plants.

3. Thus, the correct option is B. Clay-rich soils, on average, contain the largest pore space, and thus the greatest total water holding capacity.

4. Thus, the correct option is D. Soil filters water and serves as a growing medium for billions of species, contributing to biodiversity, and provides the majority of antibiotics needed to treat diseases.

5. Thus, the correct option is A. Pots, toys, and statues are all made from clayey soil.

6. Thus, the correct option is D.  Decayed organism like plants and animals make soil fertile and add nutrients to the soil.

7. Thus, the correct option is C. Sand is found on almost every beach. The action of the waves aids in the shaping of shorelines. Waves take sand from shorelines during erosion. Waves deposit sand along shorelines during deposition.

8. Thus, the correct option is D. The intermediate layer of the soil is where we normally find loam. Pulverized soil with an equal quantity of sand and slit is known as loamy soil. It also has clay in it. On the E horizon, there is loamy soil.

For more information regarding soil, visit:

https://brainly.com/question/25831026

#SPJ1

18. Brayden is trying to figure out how petal shape is determined in two different roses. In the pink rose, the copies of the gene are the same as each other. In the yellow rose, the copies of the gene are different from each other. How does this affect how many types of proteins there are in each petal cell?

Answers

The pink rose has a type of protein for the petal shape on the other hand, the yellow rose has two types of protein for the petal shape feature.

What is the relation of protein with plant characteristics?

Plant proteins also like other proteins, provide a variety of enzymatic, structural, and functional functions.

They also serve as storage media to suit the nutritional and development requirements of growing seedlings.

These can also responsible for coloration in plants.

Thus, as in the given scenario, the pink rose has a type of protein for the petal shape on the other hand, the yellow rose has two types of protein for the petal shape feature.

For more details regarding proteins in plants, visit:

https://brainly.com/question/26125134

#SPJ1

i’m stuck please help it’s due and grades are closing

Answers

Yellow is dominant because it is the trait that is expressed in the phenotype. (They all came out yellow)

This is the first generation so we call it f1 or f1 generation

When the f1 generation cross breed 75% will be yellow (they will express the dominant yellow trait) and 25 % will be red.

I’ve added a photo which is an example of this pattern

genetic drift simulation:
Why did you have to "restock" your bag between generations? How does this relate to genotypes and inheritance?​

Answers

Unlike natural selection, genetic drift does not depend on an allele's beneficial or harmful effects. Instead, drift changes allele frequencies purely by chance, as random subsets of individuals (and the gametes of those individuals) are sampled to produce the next generation.

How is childbirth an example of a
positive feedback mechanism?
A. The fetus of a human grows and as it grows
larger the uterus of the mother grows larger.
B. The release of oxytocin leads to increased
contractions which produces more oxytocin.
C. The fluid in the placenta begins to be filtered
out so the baby falls lower.
D. A chemical is released at fertilization that
stimulates the growth of the fetus that releases
more.

Answers

The release of oxytocin leads to increased contractions which produce more oxytocin. thus option B is correct.

What do you mean by the positive feedback mechanism?

A system for positive feedback In reaction to an output variation, homeostasis is a mechanism that leads the output to fluctuate even more in the direction of the initial deviation. A positive feedback system amplifies errors and affects the state of the output.

Oxytocin has the effect of imitating more contractions, and so more Oxytocin is released as a result! It's a never-ending cycle of rising contractions and hormone levels to help push the baby.

Learn more about the feedback mechanism here:

https://brainly.com/question/1121011

#SPJ1

Why are fats a better source of energy than carbohydrates on a per carbon basis?.

Answers

It one triglyceride molecule yields three fatty acid molecules with as much as 16 or more carbons in each one, fat molecules yield more energy than carbohydrates and are an important source of energy for the human body.

Fats and carbohydrates are the macromolecules that are energy sources. Fats are a better source of energy than carbohydrates as three fatty acid molecules have energy equivalent to 16 carbons.

What are fats?

Fats are the energy-providing macromolecule and are stored in the adipose tissue. They are made of fatty acids that are the source of the energy.

Fats contain the triglyceride molecule that produces fatty acids that produce the equivalent energy as the sixteen carbon molecules and hence are a more efficient source.

Therefore, fats are a better source of energy.

Learn more about fats here:

https://brainly.com/question/24618389

#SPJ2

correct order of steps for cleaning and sanitizing

Answers

Answer:

D.

Explanation:

soak in warm water, scrape up food clean with sanitizer rinse and towel dry

Why because,

Soaking will enable leftovers to remove with ease

So first soak in lukewarm water

Just took the test answer is D.

Identify the leaf tissues.
a. _________
b. _________
c. _________
d. _________

Answers

Answer:

a. Vascular

b. dermal

c. ground

d. dermal

Explanation:

Vascular is the bundle of phloem and xylem.

Dermal is epidermis, so for "b." it is upper epidermis and for "d." it is lower epidermis.

Ground provide structure.

The correct identification of leaf tissues of A, B, C and D are Vascular tissue, Dermal Tissue, Ground tissue and Dermal tissue respectively.

The specialized tissues that make up plant leaves are known as leaf tissue. Photosynthesis, gas exchange and transpiration in plants are mainly carried out by the leaves. Different types of cells perform different activities in leaf tissues.

The epidermis of the leaf, which covers both the upper and lower surfaces, is the outermost layer of tissue. Through tiny pores called stomata, it regulates water loss and acts as a protective barrier.

Between the upper and lower epidermis of the leaf is a layer of tissue called the mesophyll. It is in charge of most of the photosynthesis.

The movement of water, nutrients and carbohydrates throughout the leaf and throughout the plant is carried out by vascular tissues.

Guard cells: Special cells that surround and control the opening and closing of the stomata are found in the epidermis.

The correct identification of leaf tissues of A, B, C and D are Vascular tissue, Dermal Tissue, Ground tissue and Dermal tissue respectively.

Learn more about Leaf tissues, here:

https://brainly.com/question/14294912

#SPJ2

How do different parts of the body interact to maintain homeostasis?

Answers

Explanation:

Your circulatory system delivers oxygen-rich blood to your bones. Meanwhile, your bones are busy making new blood cells. Working together, these systems maintain internal stability and balance, otherwise known as homeostasis. Disease in one body system can disrupt homeostasis and cause trouble in other body systems.

When performing a self rescue, when should you swim to shore?.

Answers

Self rescue when being done should involve an individual choosing to swim to shore as the last option.

What is Self rescue?

These are different forms of methods which are done by individuals to pull out of dangerous situations which may cause them being stranded.

It is always best to get to the shore through every possible means so as to prevent drowning and other unpleasant situations thereby making it the correct answer.

Read more about Self rescue here https://brainly.com/question/4850006

#SPJ4

Can Someone PLEASE ANSWER This.

Which of the flowing best describes the gradual return of plants and others species to area after an ecological disturbance?

1- Biodiversity
2- Assimilation
3- Succession
4- Percolation

Answers

Answer:

3 - Succession

Explanation:

Biodiversity is the variety of life that is on Earth.

Assimilation is when animals absorb vitamins, minerals, etc. as part of the organisms nutrition.

Succession is the how the population of species in an area change over time. Which can be due to an ecological disturbance.

Percolation is the process by which materials (such as water) move through soil.

I hope this helps! If you have any questions about what I said, please leave them down in the comments!

Why should you avoid spreading non-native species between waterways?.

Answers

You should avoid spreading non-native species between waterways due to the protection of the native species in the water.

What is Species?

Species may be defined as a group of organisms that can reproduce innately with one another and produce fertile offspring.

The complete question is as follows:

Why should you avoid spreading non-native species between waterways?

to keep the number of native species from increasing.to reduce the amount of fuel your vessel needs.to prevent an accident with another vessel.to protect the native species in the water.

Waterways naturally have native species in them that have acclimated to the water and live off of its resources.

Therefore, the correct option for this question is D.

To learn more about Non-native species, refer to the link:

https://brainly.com/question/14188968

#SPJ1

Darwin saw populations of various species that seemed well-suited to their environment. What did this suggest?

Answers

Answer:

Species adapte to their environment over time.

The best method to improve air quality is to
a. use technology to reduce the pollutants in air
b. produce less pollution
C. produce less pollution and use technology to reduce the pollutants in air
d. better utilize land and technology to prevent pollution
Please select the best answer from the choices provided

Answers

a. Use technology to reduce the pollutants in air

What does oxygen poor blood deliver to the
lungs?
A. carbon dioxide
B. glucose
C. water
D. ATP

Answers

Answer:

A.carbon dioxide

Explanation:

oxygen poor blood means the blood is rich with Carbon dioxide

The oxygen poor blood delivers to the lungs carbon dioxide out of the body organs and cells. Thus, the correct option is A.

What is oxygen poor blood?

The heart is divided into two separate pumping systems, which include the right side and the left side. The right side of the heart receives oxygen-poor blood that is deoxygenated blood from the veins and pumps it to the lungs, where the blood picks up oxygen gas from the alveoli and gets rid of carbon dioxide gas.

Deoxygenated blood has less oxygen or it is oxygen-poor and contains is carbon dioxide rich. The right heart pumps this deoxygenated blood to the lungs where it picks up additional oxygen gas.

As the blood travels through body, oxygen gas is used up, and the blood becomes oxygen poor or carbon dioxide rich. Oxygen-poor blood returns from the body to the heart by the superior vena cava and the inferior vena cava, the two main veins which bring blood back to the heart.

Therefore, the correct option is A.

Learn more about Blood here:

https://brainly.com/question/14781793


#SPJ2

Photosynthesis is an integral part of what cycle?

Answers

Answer:

photosynthesis is a part of the global carbon cycle

Which system sends messages through nerves to and from all parts of you body?
A) Muscular system
B) Skeletal system
C) Digestive system
D) Nervous System

Answers

According to the research, the nervous system sends messages through nerves to and from all parts of you body.

What is the nervous system?

It is the system that directs, supervises and controls all the functions and activities of the body.

It comprises a set of regulatory organs and specialized cells that are responsible for capturing and processing messages so that the body develops an effective interaction with the environment.

Therefore, we can conclude that according to the research, the nervous system sends messages through nerves to and from all parts of you body.

Learn more about the nervous system here: https://brainly.com/question/13487019

#SPJ1

For which phenotypes in the table can you determine a person’s genotype without ever having seen his or her parents?

Answers

If its a recessive phenotype, you’ll know it’s a recessive genotype due to the fact that this genotype is only expressed when both genes are recessive. If it were dominant then the genotype could be homozygous or heterozygous

What is a potential risk associated with light skinned people living in areas near the equator? They may develop a vitamin D deficiency They will develop a supressed immune system They will develop Muscle weakness They are at a higher risk of developing skin cancer

Answers

Answer:

They are at a higher risk of developing skin cancer.

Explanation:

They get sunburned more easily, and that correlates to skin cancer development.

Please I need help now !!!!!!

The Moving Man Virtual Lab Distance, placement, Spe
The moving man travels a distance of 5 m in 10 s. What was the Moving Man's speed?

Answers

Answer:

0.5m/s

The velocity is equal to the distance over time, so we divide 5 by 10

Carbon dioxide enters the plant only through the roots.

A. True

B. False​

Answers

Answer:

False

Explanation:

CO2 enters a plant through the stomata. Tiny pores on the surface of the leaves

I'll mark brainlist!!!!
assuming that the human population on earth will peak sometime in the twenty-first century, the twenty-second century will witness a declining world population. discuss how you imagine life in the twenty-second century will be in terms of the use of nonrenewable and renewable resources, economic and social development, and quality of life.

Answers

Because nonrenewable resources are diminishing in number, they will eventually become scarce, posing a variety of life dangers in the future.

What are Non-renewable resources?

Nonrenewable resources are defined as substances that are depleted faster than they can be replaced.

Renewable resources are abundant, and capturing them is a sign of new life on the horizon. It is necessary to decrease your reliance on nonrenewable resources. As we saw during the corona pandemic, most countries' economies are progressively deteriorating. It also has an impact on one's quality of life. As a result, it must be stated that the world population will decline in the twenty-second century.

For more information regarding Non-renewable resources, visit:

https://brainly.com/question/14432353

#SPJ1

Please help ASAP
Write the characteristics in which porifera differ from the characteristics of animal kingdom?​

Answers

Answer:

see the file attached!!

Are marine volcanoes more explosive than land volcanoes?

Answers

Answer:

Yes

Explanation:

It depends on what type of volcano you may be talking about. But most of the time an underwater volcano may be more explosive. With less impact from the increased density underwater, volcano activity is more common underwater.

Other Questions
the prom committee is made up of 8 boys and girls. If there are 12 boys and 15 girls in the group to pick the committee from, how many ways can the committee be organized?1). 1860 ways2). 3185325 ways3). 2220075 ways4). 675675 waysThanks guys!! Does the table below represent a function? Why or Why Not? What are two possible measures of the angle below? A baseball is thrown into the air from a height of 5 feet. the ball reaches a maximum height of 43.5 feet and spends a total of 3.2 seconds in the air. which equation models the height of the baseball? assume that acceleration due to gravity is 16 ft/s2. h(t) = 16t2 49.64t 5 h(t) = -16t2 5t 49.64 h(t) = -16t2 49.64t 5 h(t) = 16t2 5t 49.64 After the soviet union collapsed, it was replaced by. Write down the different ways in which people of different culture and nations unite as one and be considered as a single citizen of the world. Dont know how to solve Which description best identifies the unique attributes of connective tissue?. if someone is predisposed to a disease they are more likely to contract the disease to A researcher wishes her patients to try a new medicine for depression. how many different ways can she select 5 patients from 50 patients? a. 1.2K =what is the ohms It cost Makayla $2.80 to send 28 text messages. How much would it cost to send 163 text messages? All aspects of the Kirby-Bauer test are standardized to assure reliability. What might be the consequence of pouring the plates 2mm deep instead of 4mm deep please help Which statement is true about a nickel-cadmium dry cell?The anode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+2OHCd(OH)2+2e.The cathode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+NiO2+2H2OCd(OH)2+Ni(OH)2. A die has six sides, with the numbers 1, 2, 3, 4, 5, and 6. What is the probability of rolling a number greater than 2? Rachel rides her bike due east at 9 miles per hour. Amos rides his bicycle due north at 12 miles per hour. If they left from the same point at the same time, how far apart will they be in 1 hour? Geometry and measurement :))) help please. In a city, the distance between the library and the police station is 3 miles less than twice the distance between thepolice station and the fire station. The distance between the library and the police station is 5 miles. How far apartare the police station and the fire station?O 1 mileO 3 milesO4 milesO6 miles The probability of rain on the last day of July is 95 % . If the probability remains constant for the first seven days of August , what is the probability that it will rain at most two of those seven days in August ? Find the Mean , Standard Deviation , and Variance . If you wanted to make the graph of y=3x+1 steeper which equation could you use PLSS ANSWER MY QUESTION IN THE PICTURE NONSENSE ANSWER REPORT WRONG ANSWER REPORT CORRECT ANSWER brainlist or follow