What is arcade in south Center

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

Answer: No combustion

Explanation:

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

Answer:

the answer is A

Explanation:

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

Answer:

N2O

Explanation:

hope am right.....

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.

Explanation:

Have a great rest of your day
#TheWizzer

Answer:

sea water

Explanation:

a sea water can match the following

Answer:D) it is used as an insulator

Explanation:

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

The number of molecules : 4.967 x 10²⁴

A mole is a number of particles(atoms, molecules, ions)  in a substance

This refers to the atomic total of the 12 gr C-12  which is equal to 6.02.10²³, so 1 mole = 6.02.10²³ particles  

Can be formulated :

N = n x No

N = number of particles

n = mol

No = 6.02.10²³ = Avogadro's number

8.25 moles of C₈H₁₈

The number of molecules :

[tex]\tt 8.25\times 6.02\times 10^{23}=4.967\times 10^{24}[/tex]

Answer:

Diphosphorus pentabromide is the official name.

Explanation:

Answer:

Carbon dioxide

Explanation:

In the making of the muffins, there are many ingredients are used including flour, egg, butter, sugar, and flavoring of fruits. There is also a raising agent, the baking powder or baking soda used that reacts with the batter.

This reaction form bubbles of carbon dioxide, trapped in the air spaces during the baking and muffin raises. Carbon dioxide makes muffins light, by lifting the batter as it bakes.

Answer:

potential energy (im positive that its right)

Answer:

Vaporization and Sublimation

Explanation:

Answer:

Well there's solid states, liquid states, and gas states in matter.

Answer:

Explanation:

electrolysis is the technique that use direct current to drive a non spontaneous chemical reaction chemical reaction is the gain or lose of electron this technique is use to extract metal from theirs ores

Answer:

78kJ

Explanation:

Energy change = Energy in (reactants) - Energy out (products)

According to this question, energy is released, meaning that the reaction is EXOTHERMIC. Hence, the energy change will be negative (-) i.e bond energy of reactants is greater than bond energy of products.

Energy in = bond energy of reactants = 43kJ

Energy out = bond energy of products = ?

Energy change of exothermic reaction = -35kJ

Therefore;

-35kJ = 43kJ - x

x = 35kJ + 43kJ

x = 78kJ

The bond energy of the products is 78kJ.

The balanced chemical equation :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

A balanced chemical reaction shows that the number of atoms of the reactant and the number of atoms of the product is the same

When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl) .

This statement shows that

Reactants (located to the left of the reaction)

Baking soda (NaHCO₃) and Hydrochloric acid (HCl)

product (located to the right of the reaction)

Carbon dioxide(CO₂),water  (H₂O) and Sodium chloride (NaCl).

So the reaction :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

Covalent compounds are named by using numerical prefixes to identify the number of atoms in the molecule. E.g. Mono, Di, tri, tetra, etc.

In the naming, never use mono- for the first element.

The first element keeps its name.

The second element always end in the suffix -ide.

Drop the double vowel for the prefix and the element of the second element in the compound.

Hope this helped!

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Answer:

Atoms models are bigger but they don not match the true or positive way of atoms. to make them visible scientists make their models that resembled with the real ones.

Explanation:

Molecules are microscopic entities and only can be seen under a  microscope.

Answer:

Explanation:

x thickness of a leaf x grain of salt

_____atom _____protein molecule

x width of hair x DNA

x piece of sawdust x eye of an ant

_____Water molecule x tiny seed

x bread crumb x larva of a tiny fruit fly

x bacteria x period at end of sentence _____ virus

x speck of pepper _____chromosome x frog embryo x dust mite xpoint of a pin x flea egg

Answer:

The charge is +2

Explanation:

Protons are positive, electrons are negative. 10-8=2.

+2 :)

A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2. Therefore, the correct option is option B.

The smallest unit of matter that may be split without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. As a result, the atom serves as the fundamental unit of chemistry.

Space makes up the majority of an atom. The remainder is made up of a cloud of electrons with negative charges around a positive-charged nucleus made up of protons and neutrons. Compared to electrons, that are the lightest positive ions in nature, the nucleus is tiny and dense. A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2.

Therefore, the correct option is option B.

To know more about atom, here:

https://brainly.com/question/29712157

#SPJ6

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.