What is the percentage of oxygen in AgNO3?

Answers

Answer 1

28% is the percentage of oxygen in AgNO₃ by mass.

What is percentage by mass?

Mass percent is a way of expressing concentration or describing a component in a particular mixture. The composition of a solution can be expressed in mass percent and indicates the mass of solute present in a given mass of solution. The amount of solute is expressed in mass or moles. This formula helps indicate the minimum number of moles and the relative number of atoms of each element in the compound. With the help of molecular formulas, chemists can also calculate the actual molecular formula. This formula gives the exact number of atoms in the compound.

To calculate the mass percent of an element in a compound, divide the mass of the element in 1 mole of the compound by the molar mass of the compound and multiply the result by 100.

Given,

Molecular mass of AgNO₃ = 169.87 g/mol

Molecular mass of O in AgNO₃ = 16 × 3

= 48 g/mol

% of oxygen in AgNO₃ = (48/169.87) × 100

= 0.28 × 100

= 28%

To know more about percentage by mass, visit:

https://brainly.com/question/16885872

#SPJ1


Related Questions

What is the half life of this element?
A. 80 days B. 40 days C. 5 days D. 10 days

Answers

Answer:

c. 5days

Explanation:

there is no question but if it's a graph

the answer is 5days

9. In a laboratory experiment, two groups of rats are fed two different fatty acids as their sole source of carbon for a month. The first group gets heptanoic acid (7:0), and the second gets octanoic acid (8:0). After the experiment, a striking difference is seen between the two groups. Those in the first group are healthy and have gained weight, whereas those in the second group are weak and have lost weight as a result of losing muscle mass. What is the biochemical basis for this difference

Answers

Answer:

Beta oxidation of the odd chain heptanoic acid will produce propionyl CoA, which can be converted in several steps to oxaloacetate. Oxaloacetate is the starting material for the process of gluconeogenesis (producing glucose from noncarbohydrate precursors). This gives extra glucose to the first group, so they will be healthier and gain weight. Beta oxidation of the even chain will entirely be oxidized to acetyl Co-A (one of the precursors of the TCA cycle). This will lead to a large excess of ketone bodies instead of glucose for energy, which will lead to the second group being weak and losing weight.

Explanation:

The difference is seen in having an odd chain and an even chain of fatty acids and how they are broken down and used in the body.

PLEASE Answer asap! Compare two periodic families below. You must include at least two facts about each family. You may use any description of properties or periodic trends to help you.

Answers

Answer:

The alkali metals/group 1 are recognized as a group and family of elements. These elements are metals. Sodium and potassium are examples of elements in this family. Hydrogen is not considered an alkali metal because the gas does not exhibit the typical properties of the group. The largest family of elements consists of transition metals/group 3-12/group 3a. The center of the periodic table contains the transition metals, plus the two rows below the body of the table (lanthanides and actinides) are special transition metals. Even though both are metals, transition metals have higher melting points; they have higher density; they are less reactive with water; they react and form ions with different charges, but Group 1 metals only form 1+ ions. (Hope the is helpful! You can reword it if you want...)

1. What is the symbol for atomic mass? What are the units of atomic mass in terms of atoms? 2. What is the symbol for molar mass? What are the units of molar mass? 3. What is the atomic mass of iron, with units? 4. What is the molar mass of iron, with units? 5. What is formula mass? What are the units of formula mass? 6. What is the formula mass of sodium bicarbonate, with units? 7. What is the molar mass of sodium bicarbonate with units? 8. What is the molar mass of water? 9. What is the molar mass of ammonia, NH3? 10. What is the molar mass of lithium oxide? 11. What is the molar mass magnesium bicarbonate? 12. What is the molar mass of cobalt(III) carbonate?​

Answers

i am NOT gonna read all of that

How many grams is 2.393 x 10^24 atoms of O?
70.45 g O
140.9 g O
63.58 mole O
63.58 g O

Answers

Answer:

63.58 g O

Explanation:

To calculate the mass of O atoms, the number of moles of O atoms are needed and can be calculated as follows:

n (no. of moles) = nA ÷ 6.02 × 10^23

n = 2.393 x 10^24 ÷ 6.02 × 10^23

n = 0.398 × 10^ (24-23)

n = 0.398 × 10^1

n = 3.98moles.

To calculate the mass of Oxygen, we use the following formula:

moles = mass/molar mass

Molar mass of O = 16.

3.98 = m/16

m = 3.98 × 16

m = 63.68grams of Oxygen.

Answer:

Solution given:

[tex]1 mole \:of O=6.023×10^{23} atoms[/tex]

1 mole of O =16g

we have

[tex] 6.023×10^{23} atoms\: of O=16g[/tex]

now

[tex] 2.393 × 10^{24} atoms\: of \:O\\=16/6.023×10^{23}*2.393 x 10^{24}g\\=63.57g[/tex]

63.57g is a required mass of O.

Are the following equations balanced or unbalanced?

1. SnO2 + 2H2 → Sn + 2 H2O


2. 4NH3 + 5O2 → 4NO + 6H2O


3. 2B2Br6 + 5HNO3 2 B(NO3)3 + HBr



4. 2KNO3 + 1H2CO3 → 1K2CO3 + 2HNO3

Answers

1. balanced
2. balanced
3. unbalanced
4. balanced

How do i calculate speed and find the direction of a moving object

Answers

To solve for speed or rate use the formula for speed, s = d/t which means speed equals distance divided by time.

The direction of a moving object is the direction the velocity vector points in. Where v1/2 is the magnitude of the velocity halfway to the top of the trajectory. So vdown=−vup - the two velocity vectors point in opposite directions not the same direction.

Question is in picture

Answers

Answer:

30

Explanation:

I believe it's 30 because half of 24 is 12 and that is its half life. And as you know it took 30 minutes to get there.

Use words from the box to complete the sentences.

fungi pathogen poison vaccine virus

(a) A bacteria that can cause a disease is an example of a..................................

(b) An obligate parasite that must inhabit a host cell to reproduce is a ...................................

Answers

Answer:

a) pathogen

b) virus

Explanation:

pathogens are harmful bacteria

viruses depend on the host to survive

Calculate the pH for a 1.0 x 10-5 M solution of OH at 25°C.
pH = -log[H*), pOH = -log[OH-]
14 = pH + POH
0 pH = 11.00
0 pH = 9.00
0 pH = 6.00
0 pH = 3.00

Answers

Answer:

ph=9.00

Explanation:

Given 1.0x10^-15M of OH at 25c

first find Poh from Poh=-log[OH]

then Poh=-log[1.0x10^-5]

from above Ph=5

then find Ph from ph+poh =pw

where pw=14

so

ph+5=14

ph=9.00

The pH for a 1.0 x 10-5 M solution of OH at 25°C is 9.

What is pH?pH is a measure of acidity and basicity of aqueous solution. The range of pH goes from 0 - 14, with 7 being neutral. pH of less than 7 indicate acidity, whereas a pH of greater than 7 indicates a base.pH is the measure of the relative amount of free hydrogen and hydroxyl ions in aqueous or other solutions.

In water pH + pOH=14

pH = 14 - pOH = 14 - 5 = 9

From definition, pOH = - log₁₀ [OH⁻]  

Thus pOH = -log₁₀ (1 x 10⁻⁵)

                  = - (-5) = 5

pH + pOH = 14

pH = 14 - pOH

     = 14 - 5 = 9  

pH = 9

Hence, pH = 9 is the correct answer.

To learn more about pH here

https://brainly.com/question/23051665

#SPJ2

how many atoms in 1kg of platinum
a 2.5x10^24

b 3.1x10^24

Answers

Answer:

3.1x10^24 it will be in 1 kg of platinum

A football is moving upwards towards its peak after having been booted by the punter.

Answers

Answer:

draw a square with an errow pointing down

Explanation:

Which pieces of equipment are
needed to calculate the velocity of a
falling object?
A stopwatch and balance
B speedometer and magnet
C compass and tape measure
D tape measure and stopwatch

Answers

I believe it would be D. Tape measure and stopwatch.
To calculate velocity you’ll need to know the height it is falling from and how long it takes to fall.
Hope this helps!
Please let me know if I was right.
D is the correct answer

can someone pleaze help me ​

Answers

Answer:

I think its the last one

Explanation:

Super sorry if its incorrect.

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?

Answers

Answer: your question is easy 21 L

By using ideal gas law the amount of volume will be 21 L.

What is ideal gas law?

The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.

Calculation of volume by using ideal gas law.

Given data:

P = 5.1 atm

n = 3.7 moles

T = 75°C (273 + 75) = 348 K

V = ?

Put the given data in ideal gas law.

PV = nRT

V = nRT / P

V = 3.7 × 8.31 × 348 / 5.1

V = 2098

V = 21 L

Therefore, By using ideal gas law the amount of volume will be 21 L.

To know more about ideal gas law.

https://brainly.com/question/4147359

#SPJ2

A 25.0 mL sample of HCI reacted with 20.0 mL of 2.00 M NaOH. What is the molarity of the HCI?
HCl(aq) + NaOH(aq) —> NaCl(aq) + H2O(l)
really need help!

Answers

Answer:

Molarity of HCl = 1.6M

Explanation:

The chemical reaction equation is;

HCl(aq) + NaOH(aq) —> NaCl(aq) + H2O(l)

Now, molarity = number of moles/volume

Thus, for NaOH, we have;

Number of moles = molarity × volume = 2M × (20/1000) L

Number of moles = 0.04 moles

Using the coefficients in the chemical equation above, we can find the corresponding number of moles for HCl.

Number of moles of HCl = 0.04 moles NaOH × (1 mole of HCl/1 mole of HCl) = 0.04 moles of HCl

Thus;

Molarity of HCl = 0.04/(25/1000)

Molarity of HCl = 1.6M

ANSWER ASAP Please! How do groups and periods differ? What trend specifically occurs in either?

Answers

A period is a horizontal row of the periodic table. A group is a vertical row of the periodic table. Periodic trends arise from the changes in the atomic structure of the chemical elements within their respective periods (horizontal rows) and groups in the periodic table.

What do greenhouse gases (CO2) do to the atmosphere?

Answers

Answer:

they causes climate change by trapping heat and also they contribute to respiratory diseases from smog and air pollution

Answer:

They add C02 to our atmosphere which can give plants and soils more CO2. It can also make our earths temperature change a ton!

Explanation:

Greenhouse gases produce an increase in the average surface temperature of the earth over time.

How many moles of CO2 are in 54.3 g of CO2 ?

Answers

Answer:

There is actually 1 mole in 54.3 g of CO2

what is the formula for water​

Answers

Answer:

H2O

Explanation:

EASIEST FORMULA ON EARTH

The boiling temperature of water is directly related to the atmospheric pressure. At sea level, the atmospheric pressure is 760 torr whereas the boiling temperature is 100equationC. If the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC. If the atmospheric pressure is higher than 760 torr, then you would expect the boiling temperature to be higher than 100equationC. At higher elevations, the atmospheric pressure is lower resulting in a lower boiling temperature. For example: Denver, CO experiences a boiling temperature at ~ 94equationC. If you were conducting an experiment that involved boiling water, what would you expect the boiling temperature to be if the atmospheric pressure was 790 torr

Answers

Answer:

If the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC.

B. 97.7°C

Explanation:

The question mentions the fact that temperature and pressure are directly proportional. This means that if one quantity is increasing the other increases simultaneously and vice versa.

Hence, if the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC.

From;

PαT

P=kT

Hence

P/T = k

P1/T1 = P2/T2

P1T2 = P2T1

P1 =  760 torr

T1 = 94°C

T2 = ?

P2 = 790 torr

T2 =  P2T1/P1

T2 = 790 * 94/760

T2 = 97.7°C

Of the following elements ____ can form a rare +4 ion *
a) Aluminum
b) Lead
c) Krypton
d) Uranium

Answers

Answer:

d is the answer.........

Based on Reference Table F, describe the solubility of zinc sulfide in water.

Answers

Answer:

negligible

Explanation:

negligible meaning its not very soluble in water at all

(wikipedia)

Write the complete balanced equation for Manganese & sulfuric acid --> Manganese (II) sulfate & water & sulfur dioxide

no spaces
no subscripts
no 1's for coefficients

WILL GIVE BRAINLIEST!​

Answers

Answer:

I kinda forgot. I'm sorry if I didn't answer your question.

Explanation:

Which of the following is an indication that a substance has undergone a chemical change?
A.
No new product has been formed.
B.
The color of the substance has not changed.
C.
The original constitute has not changed.
D.
The molecular structure has changed.

Answers

Answer:

D.

Hope it helps!!!!!!!!!


If we have 0.072 g of FeCl3 then how many moles are there?

Answers

Answer:

~0.0004

Explanation:

[tex]n=\frac{m}{M}[/tex]

n=0.072/(56+(35.5*3))=0.072/162.5~~0.004

Iron (III) nitrate (Fe(NO3)3) solution reacts with sodium hydroxide (NaOH) solution to form a
brown precipitate of iron (III) hydroxide (Fe(OH)3). Sodium nitrate (NaNO3) remains in solution as
it is a soluble compound.
Write the word equation and the balanced formula equation for this reaction.​

Answers

Answer:

Fe(NO3)3 + 3 NaOH ===》Fe(OH)3 + 3 NaNO3

pick one answer please do not put any links just type the answer

Answers

Answer is D
Explanation...
D. They have ways to store water for long periods of time.

Why would you rather have hot cocoa than lemonade on a cold day? (The lesson is called heat transfer)

Answers

Answer:

you would more than likely have hot coca.  

Explanation:

Because when its cold out you don't want something cold, its common sense  lol.

Other Questions
What were the accomplishments of the Tennessee Valley Authority? patients experiencing hypertension (high blood pressure) may be prescribed drugs called beta-blockers. these drugs bind to receptors on cardiac muscle cells and block the action of the sympathetic neurotransmitter (click to select) on the heart. this prevents the (click to select) effect that the sympathetic innervation would normally have on the heart. consequently, both heart rate and the force of contraction are (click to select) . What is the Lewis structure for IBr3, with the central atom of I. Is the molecular polar or nonpolar? Identify the intermolecular forces present? As defined in the hipaa privacy rule, the right to patient privacy dictates and enforces the manner in which personal health records may or may not be shared among organizations or other third parties.a. Trueb. False Did 8 is a prime number? Give the IUPAC name of the given compound. IUPAC name: What are the 5 types of income tax? Which expression is equivalent to (8102) (2.4103)? the u.s. demand for euros is multiple choice downsloping because, at lower dollar prices for euros, americans will want to buy more european goods and services. downsloping because, at higher dollar prices for euros, americans will want to buy more european goods and services. downsloping because the dollar price of euros and the euro price of dollars are directly related. upsloping because a higher dollar price of euros makes european goods and services more attractive to americans. Paul pay the newpaper company 70% of what he collect how much would he keep for himelf in a month when he collected 450. 0 Studies conducted in the united states have indicated that from early to late adolescence, the percentage of teens involved in romantic relationships? Why are digital signals more reliable than analog signals? (give an example as well please) The measures of the angles of a triangle are shown in the figure below. Solve for x.to7641 which of the following architectural features is present in this image? a. flying buttress b. rose window c. pointed arch d. archivolts What is card stacking argument? What is Scrum and kanban? Which of the following is the name of the temporary connecting blood vessel between the pulmonary artery and the aorta in the fetal heart? What are 5 examples of connotation? After the energy crisis of the 1970s and the opec oil embargo, the us _______. a. increased its dependency on foreign oil b. began to wean itself off of foreign oil and the economic vulnerability it brings c. changed over to all renewable energy sources d. began building new nuclear power plants to replace fossil fuel use What is atherosclerosis related to?