What is the value of x?
5(x+2)=11

Answers

Answer 1

Answer:

X=1.8

Step-by-step explanation:

Step one: 5 times 1.8 equals 9.

Step two: 9+2=11

Answer 2
5(x+2)=11
5x+10=11
5x=11-10
5x=1
Then divide both sides with 5( the coefficient of x)
So x= 0.2 or 1/5 still the same answer

Mark as brainleast plzzz

Related Questions

Sebastián afirma que – 14 está a la izquierda de – 10 en la recta numérica y por lo tanto es mayor, mientras que Alfredo afirma que es menor. ¿Quién está en lo correcto? Justifica.

Answers

Answer:

Alfredo está en lo correcto porque los números negativos se encuentran a la izquierda del cero y mientras más a la izquierda se encuentra un número negativo, más pequeño será y a medida que te desplazas hacia la derecha mayor será el número. Puedes representar los dos números en una recta numérica de la siguiente forma:

___________________________________________________________

-14   -13    -12    -11    -10    -9    -8    -7    -6    -5    -4    -3    -2    -1    0    1    2    3

Como se ve aquí, -14 se encuentra a la izquierda de -10 y esto significa que es menor. Por esto, Alfredo está en lo correcto al decir que -14 es menor.

PLEASE HELP ASAP!!! WILL MAKE BRAINLIEST!

Answers

Answer: Figure B is 2x bigger on all sides

Explanation: You can see that each of the numbers times 2 would equal all of the numbers on B.

Rachel’s mother tells her she can play at the arcade as long as the cost does not exceed $24. Each game costs $1.50.

Answers

Answer:

16

Step-by-step explanation:

If each game is $1.50 we would divide the 24 by 1.50, or multiple 1.50 to find 24. So 24 divided by 1.50 is 16.

So she could play 16 games.

Linear programming can be used to identify the critiacal path for a PERT network.
Group of answer choices
True
False
The probabilistic approach characterized by PERT does not use:
Group of answer choices
Median activity times
Most likely activity times
Optimistic activity times
Pessimistic activity times
The critical path:
Group of answer choices
Shows, by elimination, which activities management can safely ignore.
Is the sequential path of all of the activities from the first until the last
Is defined by activities with zero slack.
Is the shortest path through the network.
Linear programming can be used to find the optimal solution for profit, but cannot be used for nonprofit organizations.
Group of answer choices
False
True

Answers

1- True: Linear programming can be used to identify the critical path for a PERT network.

2- False: The probabilistic approach characterized by PERT does not use median activity times.

3- False: The critical path is the sequential path of activities from the first to the last, defined by activities with zero slack.

4- False: Linear programming can be used for both profit and nonprofit organizations.

Linear programming can indeed be used to identify the critical path for a PERT network. The critical path represents the sequential path of activities from the first activity to the last, and it is defined by activities with zero slack. By analyzing the dependencies and constraints between activities, linear programming techniques can be applied to determine the optimal schedule and identify the critical path.

The probabilistic approach characterised by PERT does not use median activity times. Instead, it utilises three time estimates for each activity: optimistic, most likely, and pessimistic activity times. These estimates are used to calculate the expected duration and variability of the project.

Regarding the statement about linear programming and profit optimization, it is incorrect to say that linear programming cannot be used for nonprofit organizations. Linear programming can be applied to various optimisation problems, including those related to resource allocation, cost minimisation, and efficiency improvement, which are relevant to both for-profit and nonprofit organisations.

Learn more about linear programming here, https://brainly.com/question/14309521

#SPJ11

If 10 is the area of a circle what is the radius?

Answers

Answer: 1.785

Step-by-step explanation:

Answer:

Step-by-step explanation:

To determine the radius of a circle given its area, we can use the formula:


Area = π * radius^2


Given that the area is 10, we can set up the equation as follows:


10 = π * radius^2


To solve for the radius, we need to isolate it on one side of the equation. Dividing both sides by π, we get:


10 / π = radius^2


To find the radius, we can take the square root of both sides of the equation:


radius = √(10 / π)


Using a calculator to approximate the value of π as 3.14159, we can calculate:


radius ≈ √(10 / 3.14159)

radius ≈ √(3.1831)

radius ≈ 1.7849


Therefore, the radius of the circle is approximately 1.7849 when the area is 10.


hope it helps!!

Estimate the derivative using forward finite divided difference applying both truncated and more accurate formula using 0.5 and step sizes of ht=0.25 and tu=0.125 4x12x2 + x3 -1 #x) = 5 + 3sinu = 2x1 + x2 + x3 = 4 2xy + 2x2 + x3 = 3

Answers

The more accurate forward finite divided difference estimates for the derivatives are

f₁'(x₁) = 0

f₂'(x₂) = 0

f₃'(x₃) = 0

To make it easier to work with, let's rearrange the equations in terms of the variables:

4x₁ + 2x₂ + x₃ = 1

2x₁ + x₂ + x₃ = 4

2x₁ + 2x₂ + x₃ = 3

The truncated formula for estimating the derivative using the forward finite divided difference is given by:

f'(x) ≈ (f(x + ht) - f(x)) / ht

Here, f(x) represents the function we want to differentiate, and ht is the step size.

Let's calculate the derivatives using the truncated formula for the given equations:

For x₁:

f₁'(x₁) ≈ (f₁(x₁ + ht) - f₁(x₁)) / ht

= (4(x₁ + ht) + 2x₂ + x₃ - 4x₁ - 2x₂ - x₃) / ht

= (4x₁ + 4ht + 2x₂ + x₃ - 4x₁ - 2x₂ - x₃) / ht

= (4ht) / ht

= 4

Similarly, we can calculate the derivatives for x₂ and x₃.

For x₂:

f₂'(x₂) ≈ (f₂(x₂ + ht) - f₂(x₂)) / ht

= (2x₁ + (x₂ + ht) + x₃ - 2x₁ - x₂ - x₃) / ht

= (x₂ + ht - x₂) / ht

= ht / ht

= 1

For x₃:

f₃'(x₃) ≈ (f₃(x₃ + ht) - f₃(x₃)) / ht

= (2x₁ + 2x₂ + (x₃ + ht) - 2x₁ - 2x₂ - x₃) / ht

= (x₃ + ht - x₃) / ht

= ht / ht

= 1

So, the truncated forward finite divided difference estimates for the derivatives are:

f₁'(x₁) = 4

f₂'(x₂) = 1

f₃'(x₃) = 1

The more accurate formula for estimating the derivative using the forward finite divided difference is given by:

f'(x) ≈ (-3f(x) + 4f(x + ht) - f(x + 2ht)) / (2ht)

Let's calculate the derivatives using the more accurate formula for the given equations:

For x₁:

f₁'(x₁) ≈ (-3f₁(x₁) + 4f₁(x₁ + ht) - f₁(x₁ + 2ht)) / (2ht)

= (-3(4x₁ + 2x₂ + x₃) + 4(4(x₁ + ht) + 2x₂ + x₃) - (4(x₁ + 2ht) + 2x₂ + x₃)) / (2ht)

= (-12x₁ - 6x₂ - 3x₃ + 16x₁ + 8ht + 4x₂ + 2x₃ - 4x₁ - 8ht - 2x₂ - x₃) / (2ht)

= (-12x₁ + 16x₁ - 4x₁ + 8ht - 8ht) / (2ht)

= 0

Similarly, we can calculate the derivatives for x₂ and x₃.

For x₂:

f₂'(x₂) ≈ (-3f₂(x₂) + 4f₂(x₂ + ht) - f₂(x₂ + 2ht)) / (2ht)

= (-3(2x₁ + x₂ + x₃) + 4(2x₁ + (x₂ + ht) + x₃) - (2x₁ + (x₂ + 2ht) + x₃)) / (2ht)

= (-6x₁ - 3x₂ - 3x₃ + 8x₁ + 4x₂ + 4ht + 4x₃ - 2x₁ - x₂ - x₃) / (2ht)

= (-6x₁ + 8x₁ - 2x₁ - 3x₂ + 4x₂ - x₂ - 3x₃ + 4x₃ - x₃ + 4ht) / (2ht)

= 0

For x₃:

f₃'(x₃) ≈ (-3f₃(x₃) + 4f₃(x₃ + ht) - f₃(x₃ + 2ht)) / (2ht)

= (-3(2x₁ + 2x₂ + x₃) + 4(2x₁ + 2x₂ + (x₃ + ht)) - (2x₁ + 2x₂ + (x₃ + 2ht))) / (2ht)

= (-6x₁ - 6x₂ - 3x₃ + 8x₁ + 8x₂ + 4x₃ + 4ht - 2x₁ - 2x₂ - x₃) / (2ht)

= (-6x₁ + 8x₁ - 2x₁ - 6x₂ + 8x₂ - 2x₂ - 3x₃ + 4x₃ - x₃ + 4ht) / (2ht)

= 0

To know more about derivative here

https://brainly.com/question/30074964

#SPJ4

A girl is putting jars of jam into boxes.She puts 8 jars into each box,and she has a total of 144 jars.She wants to know how many boxes she needs how much boxes does she need

Answers

Answer:

18

Step-by-step explanation:

she needs 18 boxes divide 144 by 8 then u get ur answer

In how many ways can we distribute the 52 cards deck if we want to give to Sara 17 cards, to Jacob 17 cards and to their Mam 18 cards? 1) 52!/17!17!18!

Answers

The number of ways in which 52 cards can be distributed such that Sara receives 17 cards, Jacob receives 17 cards, and their mother receives 18 cards is given by the following expression:52!/17!17!18!

Explanation: The number of ways to distribute k objects among n persons in which the order does not matter and each person receives at least one object is given by the following expression: ((k - n) choose (n - 1)). This can be extended to the case where each person is required to receive a specific number of objects. For example, if we have k objects and want to distribute them to persons A, B, and C such that A receives a objects, B receives b objects, and C receives c objects, where a + b + c = k, then the number of ways to do this is given by the expression: ((k - a - b - c) choose (2))This can be simplified as follows: ((k - a - b - c)!)/((2!)(k - a - b - c - 2)!)), which can be further simplified as follows: (k - a - b - c)(k - a - b - c - 1)/2!.

Therefore, the number of ways in which 52 cards can be distributed such that Sara receives 17 cards, Jacob receives 17 cards, and their mother receives 18 cards is given by: ((52 - 17 - 17 - 18) choose (2))= ((52 - 52) choose (2))= (0 choose 2)=0. Therefore, the required number of ways is 52!/17!17!18!.

To know more about Combination, click here:

https://brainly.com/question/20211959

#SPJ11

Please help! I know its a lot and I'm sorry but I REALLY NEED HELP!!! I just don't understand this and I don't want to fail my brain just is not smart with math. Even if you answer just ONE question it would mean the WORLD TO ME thanks!

Answers

Answer:16

Step-by-step explanation:

Find a unit vector normal to the fuxface at Point P: (1,1,2): 0.25 4- X - Y = 0 Z a) Ô = ? ń - - b) Vf-? C) vxof-?

Answers

(a) The unit vector normal to the surface at point P is n = (-2/3, -2/3, 1/3).

(b) The gradient vector ∇f = (-2x, -2y, 0.5z).

(c) The curl of the gradient vector, ∇ × ∇f, is not applicable in this case since ∇f is not a vector field, but a surface normal.

To find a unit vector normal to the surface at point P(1, 1, 2) given the equation 0.25z² - x² - y² = 0, we can follow these steps:

Step 1: Define the Surface Function

Let's define the surface function f(x, y, z) based on the given equation:

f(x, y, z) = 0.25z² - x² - y²

Step 2: Calculate the Gradient Vector (∇f)

The gradient vector (∇f) represents the vector of partial derivatives of the surface function. Calculate ∇f(x, y, z) by taking the partial derivatives of f(x, y, z) with respect to each variable:

∂f/∂x = -2x

∂f/∂y = -2y

∂f/∂z = 0.5z

Thus, the gradient vector (∇f) is (∇f) = (-2x, -2y, 0.5z).

Step 3: Evaluate ∇f at Point P

Evaluate the gradient vector (∇f) at point P(1, 1, 2) by substituting the coordinates into (∇f):

∇f(P) = (-2(1), -2(1), 0.5(2))

= (-2, -2, 1)

Step 4: Normalize the Normal Vector

To obtain a unit vector normal to the surface at point P, we need to normalize (∇f(P)) by dividing it by its magnitude.

Magnitude of ∇f(P) = √((-2)² + (-2)² + 1²)

= √(4 + 4 + 1)

= √9

= 3

The unit vector normal to the surface at point P is then:

n = (∇f(P)) / |∇f(P)|

= (-2, -2, 1) / 3

= (-2/3, -2/3, 1/3)

So, the unit vector normal to the surface at point P(1, 1, 2) is n = (-2/3, -2/3, 1/3).

Learn more about the unit vector normal at

https://brainly.com/question/29752499

#SPJ4

The question is -

Find a unit vector normal to the surface at Point P: (1,1,2):

0.25z² - x² - y² = 0

(a) n = ?

(b) ∇f = ?

(c) ∇ × ∇f = ?

write a equation in slope intersect form for points (0,8) and (9,5)

Answers

y = mx+b

(5-8)/(9-0) = -1/3 which is m

solve point slope to find slope intercept by using one of the points (0,8)

y-y1=m(x-x1)

y-8 = -1/3(x-0)

y-8 = -1/3x

Answer: y = -1/3x + 8

Charlotte bought 18 songs for her MP3 player. Three-thirds of the songs are classical songs. How many of the songs are classical songs?

Answers

Answer:

three thirds is one whole

Step-by-step explanation:

The answer is 18 because three thirds is one whole which in this case is 18! Have a nice day!

ues a net to find the surface area of the pyramid?

Answers

The surface area is 624 inches squared.
Multiply 12 by 20 to get 240, then divide it by 2 to get 120 for the area of one triangular side.
Multiply 120 by 4 for the four triangular sides to get 480 inches squared.
Then multiply 12 by 12 for the base which will be 144 inches.
480 plus 144 equals 624 inches squared!
:D Goodluck on the rest of your homework or quiz!

Please help me with this question

Answers

Answer:

c is your answer

Step-by-step explanation:

The Spirit Team will be selling popcorn as a fundraiser at the next basketball game to earn funds to go to Orlando for a competition. If they need the volume of the popcorn container to be under 220 cubic inches per serving, select all of the following dimensions of a cylinder they could use.




3 inch radius and 4 inch height


4 inch radius and 4 inch height


9 inch radius and 9 inch height


4 inch diameter and 9 inch height


6 inch diameter and 9 inch height


9 inch diameter and 4 inch height

Answers

Answer:A and b

Step-by-step explanation:

The dimensions of cylinders that have a volume under 220 cubic inches per serving are:

3-inch radius and 4-inch height
4-inch diameter and 4-inch height
4-inch diameter and 9-inch height

What is volume?

Volume is defined as the mass of the object per unit density while for geometry it is calculated as profile area multiplied by the length at which that profile is extruded.

Here,
We can use the formula V = πr²h to find the volume of each cylinder.

For a cylinder with a 3-inch radius and 4-inch height:

V = π(3)²(4) ≈ 113.1 cubic inches

For a cylinder with a 4-inch radius and 4-inch height:

V = π(4)²(4) ≈ 200.96 cubic inches

For a cylinder with a 9-inch radius and 9-inch height:

V = π(9)²(9) ≈ 2289.0 cubic inches

For a cylinder with a 4-inch diameter and 9-inch height (radius is 2 inches):

V = π(2)²(9) ≈ 113.04 cubic inches

For a cylinder with a 6-inch diameter and 9-inch height (radius is 3 inches):

V = π(3)²(9) ≈ 254.5 cubic inches

For a cylinder with a 9-inch diameter and 4-inch height (radius is 4.5 inches):

V = π(4.5)²(4) ≈ 254.5 cubic inches

Therefore, the dimensions of cylinders that have a volume under 220 cubic inches per serving are:

3-inch radius and 4-inch height
4-inch diameter and 4-inch height
4-inch diameter and 9-inch height

Learn more about Volume here:
https://brainly.com/question/1578538

#SPJ3

Show that the function f(x) f(x) = x3, x < 0 1 x2 sin, x > 0 x is differentiable.

Answers

To show that the function f(x) = x³ for x < 0 and f(x) = x²sin(x) for x > 0 is differentiable, we need to demonstrate that the function has a derivative at every point in its domain.

Let's consider the function f(x) separately for x < 0 and x > 0.

For x < 0

In this case, f(x) = x³. The power rule tells us that the derivative of xⁿ with respect to x is nxⁿ⁻¹. Applying this rule, we find that the derivative of f(x) = x³ is f'(x) = 3x².

For x > 0

In this case, f(x) = x²sin(x). The product rule is used when we have a function that is the product of two other functions. The derivative of f(x) can be calculated as follows

f'(x) = (x²)' sin(x) + x² (sin(x))'

To find the derivative of x² sin(x), we use the product rule again

(f(x)g(x))' = f'(x)g(x) + f(x)g'(x)

Let f(x) = x² and g(x) = sin(x). We have

f'(x) = 2x

g'(x) = cos(x)

Substituting these values back into the product rule equation

f'(x) = (x²)' sin(x) + x² (sin(x))'

= (2x) sin(x) + x^2 cos(x)

Therefore, the derivative of f(x) = x²sin(x) is f'(x) = (2x) sin(x) + x²cos(x).

Now, we have found the derivatives of f(x) for both x < 0 and x > 0. To show that f(x) is differentiable, we need to verify that the derivatives from both cases match at x = 0.

As x approaches 0 from the left side (x < 0), we have

lim(x → 0⁻) f'(x) = lim(x → 0⁻) 3x² = 0

As x approaches 0 from the right side (x > 0), we have

lim(x → 0⁺) f'(x) = lim(x → 0⁺) (2x) sin(x) + x²cos(x) = 0

Since the limits of the derivatives from both cases are equal at x = 0, we can conclude that f(x) = x³ for x < 0 and f(x) = x²sin(x) for x > 0 is differentiable at every point in its domain.

To know more about function here

https://brainly.com/question/30721594

#SPJ4

You are given the line y=-2x-5, and it then shifted up 2 units. Write your equation of the new line.

Answers

Answer:

i think the answer is 119943147893471987 yes its as easy as 1+1

Step-by-step explanation:

Answer: y=-2x-3

Step-by-step explanation:

Help me please ahhhh...Simplify the expression below.
2.5x. 4

Answers

Just multiply, it’s 40x.

Answer:

Maybe multiply 2 and 4 then multiply 5x  of product of 2 and 4  

Step-by-step explanation:

1.Explain why we need unit root test for stationary and the meaning of a spurious regression.

2.What are autocorrelation and Durbin-Watson test? And how are they related?

3. Explain the concept of VAR and VEC model and how they differ?

4.Explain the characteristic of an ARDL and its application

5.Explain the concept of cointegration and show how to perform the test for cointegration

6.Briefly explain these following tasks of heteroskedasticity: (1) the meaning of heteroskedasticity; (2) how to detect heteroskedasticity; (3) heteroskedasticity consequences for the OLS Estimation

Answers

1. Unit root tests are used to determine whether a time series variable is stationary or contains a unit root. Stationarity is a property of a time series where its statistical properties (such as mean, variance, and autocovariance) remain constant over time.

Unit root tests are important because many econometric models and statistical techniques assume stationarity. If a variable is non-stationary, it can lead to spurious regression.  

Unit root tests help identify such cases by testing the null hypothesis of a unit root presence in the time series.

2. Autocorrelation refers to the correlation between the observations of a time series with their lagged values. It indicates the presence of a systematic relationship or dependence between the current observation and past observations.

The Durbin-Watson test is a statistical test used to detect autocorrelation in the residuals of a regression model.

The Durbin-Watson test statistic ranges from 0 to 4. A value close to 2 indicates no significant autocorrelation, while values significantly below 2 suggest positive autocorrelation, and values significantly above 2 suggest negative autocorrelation.

3. VAR models represent a system of equations where each variable is regressed on its own lagged values and the lagged values of all other variables in the system.

VAR models are widely used for forecasting, impulse response analysis, and studying dynamic relationships in macroeconomic and financial data.

VEC models, on the other hand, are a special case of VAR models designed to capture long-run equilibrium relationships among variables. VEC models incorporate error correction terms that help adjust for any deviations from the long-run equilibrium.

They are particularly useful when studying variables that exhibit cointegration, as they allow for the analysis of both short-run dynamics and long-run equilibrium relationships.

4. The Autoregressive Distributed Lag (ARDL) model is a regression model commonly used when dealing with time series data that may have a mix of stationary and non-stationary variables.

The ARDL model finds applications in macroeconomics, finance, and other fields where the relationship between variables may exhibit mixed order of integration.

5. Cointegration refers to the long-run equilibrium relationship between non-stationary time series variables. Cointegration implies that a linear combination of the variables is stationary, indicating a stable relationship.

6. Heteroskedasticity refers to the condition where the variance of the error term in a regression model is not constant across all levels of the independent variables. This violates the assumption of homoscedasticity, which assumes constant variance.

To detect heteroskedasticity, several methods can be used:

a) Graphical Analysis: Plotting the residuals against the predicted values or the independent variables to visually examine patterns of heteroskedasticity.

b) White's Test: A statistical test that regresses the squared residuals on the independent variables to test for heteroskedasticity.

Heteroskedasticity has consequences for Ordinary Least Squares (OLS) estimation:

a) OLS estimates of coefficients remain unbiased, but they are no longer efficient (standard errors are incorrect).

b) The t-tests and F-tests become invalid, leading to incorrect inference.

c) Confidence intervals and hypothesis tests may be distorted.

Correcting for heteroskedasticity can be done using robust standard errors or weighted least squares (WLS) estimation, which takes into account the heteroskedasticity structure of the error terms.

To know more about Unit root tests refer here:

https://brainly.com/question/31260248#

#SPJ11

What would the command "-index(F5:F277,randbetween(1.273))" do when entered in the spreadsheet with survey responses that we use for Project 2 (and will use for Project 3)? Return the most frequent answer to "Pineapple on pizza?" Return a random number between 1 and 273. Average the values in Column F. Change an answer in Column F at random. Pick a response at random from the responses to the question "Pineapple on pizza?" Return the greatest response to a random question

Answers

The command "-index (F5:F277, rand between (1.273))" when entered in the spreadsheet with survey responses that we use for Project 2 (and will use for Project 3) would pick a response at random from the responses to the question.

So, the correct option is: Pick a response at random from the responses to the question "Pineapple on pizza."

The INDEX function is an Excel worksheet function that finds the value or reference to a value within an array. It returns a reference to the location of the value, rather than the value itself. The INDEX function in Excel is a lookup and reference function.

The INDEX function allows you to search a spreadsheet and find the value contained in a given cell. The INDEX function takes two arguments, the array and the index number. The array is the range of cells that you want to search, while the index number is the position of the value you want to return.

To know more about function refer to:

https://brainly.com/question/11624077

#SPJ11

What is the length of the diameter?

Answers

is there any instructions above the circle?

2x the radius, the radius is half the length circle so multiplying it by 2 gets you the full length

U is the set of integers. G is the set of negative integers. What is the complement of set G in universive U?
Pls help fast

Answers

Answer:

Wouldn't the answer be C) Positive Integers?

Step-by-step explanation: Because the complement of a set include all of the elements not included in the indicated set. I hope I'm making some sense. :)

please solve for x!!!!

Answers

Answer:

-14

Step-by-step explanation:

Hello,

Let's have a look at this figure and think about how are these two angles related to each other. These two angles are vertically opposite angles, and any two vertically opposite angles should be equal to each other.

Because the two angles should be equal to each other, we can equate the two equations together and solve for x.

9x + 184 = 7x + 156

9x - 7x = 156 - 184

2x = -28

x = -14

Can someone help me with this. Will Mark brainliest. Need answer and explanation/work. Thank you.

Answers

Answer:

tangent x = 12/9

Step-by-step explanation:

Hello There!

Once again these are the Trigonometric Ratios

SOH CAH TOA

Sine = Opposite over Hypotenuse (SOH)

Cosine = Adjacent over Hypotenuse (CAH)

Tan = Opposite over Adjacent (TOA)

And for this one we are asked to find the tangent of angle x

Remember tangent = opposite over adjacent

opposite - the side length that is opposite of the angle (so the angle will be facing that side length)

adjacent - the side length that is not the opposite nor the hypotenuse

The opposite of angle x is 12 and the adjacent of angle x is 9

so tangent x = 12/9

What is the solution to the equation 3x + 2(x – 9) = 8x + X - 14?
+
o
-8
0-1
o
1
08

Answers

Answer:

Your answer will be x= -1

Step-by-step explanation:

have a nice day:)

A line has an undefined slope and includes the point (-10, 6) and (q, 0) what is the value q

Answers

Answer:

q = -10

Step-by-step explanation:

If the slope is undefined, then there is no change in x. Therefore, since -10-(-10) = 0, then q=-10.

Andrew must cut a rope 9 1/7 yards long into 8 equal
pieces. How long will each piece of rope be?

Answers

Answer:

each rope should be 1 1/7 yard long

Step-by-step explanation:

9 1/7 ÷8

1 1/7

Answer:

8/7 yd per piece

Step-by-step explanation:

To answer this, divide the total rope length 9 1/7 yd by 8 pieces:

 64 yd

------------------ = 8/7 yd per piece

7(8 pieces)

Check:  does 8 times (8/7 yd/piece) come out to 64/7 yd, or 9 1/7 yd?  YES

Suppose we are conducting a X^2 goodness-of-fit test for a nominal variable with 4 categories. The test statistic X^2 = 6.432 and α = .05. The critical value is _______ - So we _____ the null hypothesis.

Answers

The critical value for the [tex]X^{2}[/tex] goodness-of-fit test with 4 categories and α = 0.05 is approximately 7.815.

In a chi-square goodness-of-fit test, we compare the observed frequencies of a nominal variable across different categories with the expected frequencies under the null hypothesis. The test statistic, [tex]X^{2}[/tex], measures the discrepancy between the observed and expected frequencies.

To determine if the observed frequencies significantly differ from the expected frequencies, we compare the test statistic with the critical value at the specified significance level (α). The critical value is determined based on the degrees of freedom, which is the number of categories minus 1.

In this scenario, the nominal variable has 4 categories. Degrees of freedom is (4 - 1) = 3. Using the degrees of freedom and the significance level of α = 0.05, we can consult the chi-square distribution table or use statistical software to find the critical value.

The critical value for the [tex]X^{2}[/tex] goodness-of-fit test with 4 categories and α = 0.05 is approximately 7.815.

Since the test statistic [tex]X^{2}[/tex] = 6.432 is less than the critical value of 7.815, we fail to reject the null hypothesis. This means that there is not enough evidence to suggest a significant difference between the observed and expected frequencies.

Learn more about hypothesis here:

brainly.com/question/17099835

#SPJ11

the circumference is about ___ m

use 3.14 for pi.​

Answers

The circumference is:

14.6 x 3.14 = 45.844 (m)

Answer:

c = 45.8 m

Step-by-step explanation:

The diameter of this circle is 14.6 m.  The formula for the circumference of a circle of diameter d is πd.  Here, using 3.14 for π, C = (3.14)(14.6 m), or

C = 45.8 m

PLZ HELP Siri is grocery shopping. She is buying macaroni. One box is 6 inches long, 1 inch wide, and 9 inches tall. The second box is 3 inches long, 3 inches wide and 6 inches tall. Which box holds more macaroni?

Answers

Answer:  

The second box  

Step-by-step explanation:

The volume of a pyramid can be given by the formula:  V=31​Ah. Where.  A:  Area of the V=(1/3)(B)(h)

multiply both sides by 3

3V=Bh

divide both sides by B

3V/B=h

Therefore, If it is wider it has more space to carry more items such as macaroni.

Other Questions
The incremental operating cash flows of an investment may include the following: O Change in depreciation expenses Change in operating expenses Change in tax Change in revenues Change in capital outlay if you put a drinking straw in water, place your finger over the opening, and lift the straw out of the water, some water stays in the straw. explain. Se lanza un objeto hacia arriba y en 3.2 segundos cae. Determinar la altura mxima a la que lleg y la velocidad con la que choca con el piso. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g)If 9.2g of C2H5OH(l) burns completely in the presence of excess O2(g) according to the equation, how many grams of CO2(g) are produced?A:0.40gB:8.8gC:9.2gD:18g Identify the two genes of each parent that would always produce an ear of corn which has all yellow kernels. What is the distance to the nearest tenth A unit, between point M (-8,-1) and point N (3,5)? Cooley Company's stock has a beta of 0.60, the risk-free rate is 2.25%, and the market risk premium is 5.50%. What is the firm's required rate of return? Do not round your intermediate calculations.5.55%4.38%6.60%6.16%4.66% In what way did Henry Ford's use of the assembly line method of production represent an advance in technology in automobile manufacturing? a. It prevented other forms from utilizing that same technology.b. It enabled workers to become experts in every aspect of automobile assembly. c. It allowed Ford to buy parts at a lower cost. d. It allowed workers to specialize on specific tasks and become more productive.e. It caused all other automobile manufacturers to go out of business. What conflict started in 1860 when several southern states voted to secede, orwithdraw from the Union?HELP!!! Lump-Sum Purchase /Group Purchases - Exercise Assume a company purchases land, machinery and a building for RO4,000,000 cash. The land has a market value of RO1,350,000, machinery of RO675,000 and the building for RO2,475,000 for a total value of RORO4,500,000. Required: Calculate the amount at which each of the above components shall be recognized on purchase date and record the purchase transaction and record journal entries. A decrease in the price of a fixed factor of production decreases total cost and A) increases marginal cost. B) leaves marginal cost unchanged. C) decreases marginal cost. D) increases variable cost. Solve the problem. The function D(h) = 5e^-0.4h can be used to determine the milligrams D of a certain drug in a patient's bloodstream h hours after the drug has been given. How many milligrams (to two decimals) will be present after 9 hours? a. 182.99 mg b. 0.14 mg c. 1.22 mg d. 3.35 mg In 2006, a sample of 200 in-store shoppers showed that 42 paid by debit card. In 2009, a sample of the same size showed that 80 paid by debit card. (a) Formulate appropriate hypotheses to test whether the percentage of debit card shoppers increased. (b) Carry out the test at alpha assume that you were to build a new 7tesla mri system. you currently had a 3tesla mri system. which parts from the 3t could you use in the 7tesla system? explain How does Morrie know his health is failing?A: he sees how far he can walkB: he sees how much he can eatC: he times how long he exhalesD: he can no longer talk to Mitch Compare economic and non-economic arguments that nationsuse to justify protection for particular industries. When analyzing the investment quality of a mortgage bond, which of the following would be least useful to the analyst?A. The rating assigned the mortgage bond from a nationally recognized ratings service.B. Information pertaining to the collateral that backs the obligation.C. The name of the trustee that holds title to the collateral.D. General trends in the business cycle. "I wish that I was good enough"when all people do is walk in and outta your life and you get used to it but it still hurts so bad........When you don't know who to trust anymore Let v = - [3 1] and u=[2 1]. Write v as the sum of a vector in Span{u} and a vector orthogonal to u. (2) Find the distance from v to the line through u and origin. ok soooowhen you rrly think abt it we all have kicked a pregnant lady